Add new models and page for motions

.prettierrc

@@ -0,0 +1,13 @@
+{
+    "plugins": ["prettier-plugin-blade"],
+    "overrides": [
+        {
+            "files": ["*.blade.php"],
+            "options": {
+                "parser": "blade"
+            }
+        }
+    ],
+    "singleQuote": true,
+    "tabWidth": 4
+}

app/Console/Commands/ImportRiksdagData.php

@@ -0,0 +1,93 @@
+<?php
+
+namespace App\Console\Commands;
+
+use App\Jobs\ImportRiksdagDataJob;
+use Illuminate\Console\Command;
+
+class ImportRiksdagData extends Command
+{
+    /**
+     * The name and signature of the console command.
+     */
+    protected $signature = 'riksdag:import
+                            {file? : The path to the JSON file to import}
+                            {--url= : URL to download ZIP file from}
+                            {--queue : Run the import job in the background queue}';
+
+    /**
+     * The console command description.
+     */
+    protected $description = 'Import Riksdag data from a JSON file or download and process a ZIP file from URL';
+
+    /**
+     * Execute the console command.
+     */
+    public function handle()
+    {
+        $filePath = $this->argument('file');
+        $url = $this->option('url');
+
+        if (! $filePath && ! $url) {
+            $this->error('Either provide a file path or use --url option');
+
+            return 1;
+        }
+
+        if ($url) {
+            // Process ZIP from URL
+            $this->info("Starting ZIP download and import from: {$url}");
+
+            if ($this->option('queue')) {
+                ImportRiksdagDataJob::dispatch($url, true);
+                $this->info('ZIP import job has been queued. Check queue workers for progress.');
+            } else {
+                try {
+                    $job = new ImportRiksdagDataJob($url, true);
+                    $job->handle();
+                    $this->info('ZIP import completed successfully!');
+                } catch (\Exception $e) {
+                    $this->error('ZIP import failed: '.$e->getMessage());
+
+                    return 1;
+                }
+            }
+        } else {
+            // Process single file
+            if (! file_exists($filePath)) {
+                $this->error("File not found: {$filePath}");
+
+                return 1;
+            }
+
+            // Validate JSON format
+            $jsonContent = file_get_contents($filePath);
+            $testDecode = json_decode($jsonContent, true);
+
+            if (json_last_error() !== JSON_ERROR_NONE) {
+                $this->error('Invalid JSON format: '.json_last_error_msg());
+
+                return 1;
+            }
+
+            $this->info("Starting import from: {$filePath}");
+
+            if ($this->option('queue')) {
+                ImportRiksdagDataJob::dispatch($filePath, false);
+                $this->info('Import job has been queued. Check queue workers for progress.');
+            } else {
+                try {
+                    $job = new ImportRiksdagDataJob($filePath, false);
+                    $job->handle();
+                    $this->info('Import completed successfully!');
+                } catch (\Exception $e) {
+                    $this->error('Import failed: '.$e->getMessage());
+
+                    return 1;
+                }
+            }
+        }
+
+        return 0;
+    }
+}

app/Jobs/ImportRiksdagDataJob.php

@@ -0,0 +1,562 @@
+<?php
+
+namespace App\Jobs;
+
+use App\Models\DokAktivitet;
+use App\Models\DokBilaga;
+use App\Models\DokForslag;
+use App\Models\DokIntressent;
+use App\Models\DokReferens;
+use App\Models\Dokument;
+use App\Models\DokUppgift;
+use App\Models\Organ;
+use App\Models\Person;
+use App\Models\PersonUppdrag;
+use App\Models\PersonUppgift;
+use Illuminate\Bus\Queueable;
+use Illuminate\Contracts\Queue\ShouldQueue;
+use Illuminate\Foundation\Bus\Dispatchable;
+use Illuminate\Queue\InteractsWithQueue;
+use Illuminate\Queue\SerializesModels;
+use Illuminate\Support\Facades\DB;
+use Illuminate\Support\Facades\Http;
+use Illuminate\Support\Facades\Log;
+use ZipArchive;
+
+class ImportRiksdagDataJob implements ShouldQueue
+{
+    use Dispatchable, InteractsWithQueue, Queueable, SerializesModels;
+
+    protected $url;
+
+    protected $isUrl;
+
+    protected $filePath;
+
+    public function __construct(string $urlOrPath, bool $isUrl = false)
+    {
+        $this->url = $urlOrPath;
+        $this->isUrl = $isUrl;
+        $this->filePath = $urlOrPath;
+    }
+
+    public function handle()
+    {
+        try {
+            if ($this->isUrl) {
+                $this->processZipFromUrl();
+            } else {
+                $this->processSingleFile($this->filePath);
+            }
+        } catch (\Exception $e) {
+            Log::error('Error in ImportRiksdagDataJob: '.$e->getMessage());
+            throw $e;
+        }
+    }
+
+    protected function processZipFromUrl()
+    {
+        Log::info('Starting download from: '.$this->url);
+
+        // Download the ZIP file
+        $response = Http::timeout(300)->get($this->url);
+
+        if (! $response->successful()) {
+            throw new \Exception('Failed to download ZIP file from: '.$this->url);
+        }
+
+        // Create temporary directory
+        $tempDir = storage_path('app/temp/riksdag_import_'.time());
+        $zipPath = $tempDir.'/download.zip';
+
+        if (! is_dir($tempDir)) {
+            mkdir($tempDir, 0755, true);
+        }
+
+        // Save ZIP file
+        file_put_contents($zipPath, $response->body());
+        Log::info('ZIP file downloaded to: '.$zipPath);
+
+        // Extract ZIP file
+        $extractPath = $tempDir.'/extracted';
+        $this->extractZipFile($zipPath, $extractPath);
+
+        // Process all JSON files in extracted directory
+        $this->processJsonFiles($extractPath);
+
+        // Clean up temporary files
+        $this->cleanupTempDirectory($tempDir);
+
+        Log::info('ZIP processing completed successfully');
+    }
+
+    protected function extractZipFile($zipPath, $extractPath)
+    {
+        $zip = new ZipArchive;
+        $result = $zip->open($zipPath);
+
+        if ($result !== true) {
+            throw new \Exception('Failed to open ZIP file: '.$zipPath.' (Error code: '.$result.')');
+        }
+
+        if (! is_dir($extractPath)) {
+            mkdir($extractPath, 0755, true);
+        }
+
+        $zip->extractTo($extractPath);
+        $zip->close();
+
+        Log::info('ZIP file extracted to: '.$extractPath);
+    }
+
+    protected function processJsonFiles($directory)
+    {
+        $jsonFiles = glob($directory.'/*.json');
+
+        if (empty($jsonFiles)) {
+            // Check subdirectories
+            $subdirs = glob($directory.'/*', GLOB_ONLYDIR);
+            foreach ($subdirs as $subdir) {
+                $jsonFiles = array_merge($jsonFiles, glob($subdir.'/*.json'));
+            }
+        }
+
+        Log::info('Found '.count($jsonFiles).' JSON files to process');
+
+        foreach ($jsonFiles as $jsonFile) {
+            Log::info('Processing file: '.basename($jsonFile));
+            $this->processSingleFile($jsonFile);
+        }
+    }
+
+    protected function cleanupTempDirectory($tempDir)
+    {
+        $this->deleteDirectory($tempDir);
+        Log::info('Temporary directory cleaned up: '.$tempDir);
+    }
+
+    protected function deleteDirectory($dir)
+    {
+        if (! is_dir($dir)) {
+            return;
+        }
+
+        $files = array_diff(scandir($dir), ['.', '..']);
+        foreach ($files as $file) {
+            $path = $dir.'/'.$file;
+            is_dir($path) ? $this->deleteDirectory($path) : unlink($path);
+        }
+        rmdir($dir);
+    }
+
+    protected function processSingleFile($filePath)
+    {
+        try {
+            $jsonContent = file_get_contents($filePath);
+            $data = json_decode($jsonContent, true);
+
+            if (json_last_error() !== JSON_ERROR_NONE) {
+                throw new \Exception('Invalid JSON format: '.json_last_error_msg());
+            }
+
+            DB::beginTransaction();
+
+            // Handle new JSON structure with dokumentstatus wrapper
+            if (isset($data['dokumentstatus'])) {
+                $this->processDocumentStatus($data['dokumentstatus']);
+            }
+            // Legacy support for old structure
+            elseif (isset($data['dokumentlista'])) {
+                $this->importDokumentData($data['dokumentlista']);
+            } elseif (isset($data['personlista'])) {
+                $this->importPersonData($data['personlista']);
+            } elseif (isset($data['organlista'])) {
+                $this->importOrganData($data['organlista']);
+            }
+            // Handle single document structure
+            elseif (isset($data['dokument'])) {
+                $this->importSingleDokument($data['dokument']);
+            }
+
+            DB::commit();
+            Log::info('Successfully imported data from: '.$filePath);
+
+        } catch (\Exception $e) {
+            DB::rollBack();
+            Log::error("Error importing data from {$filePath}: ".$e->getMessage());
+            throw $e;
+        }
+    }
+
+    protected function processDocumentStatus($dokumentStatus)
+    {
+        // Process the main document
+        if (isset($dokumentStatus['dokument'])) {
+            $this->processDokument($dokumentStatus['dokument']);
+        }
+
+        // Get hangar_id for related data processing
+        $hangarId = $dokumentStatus['dokument']['hangar_id'] ?? null;
+
+        if (! $hangarId) {
+            throw new \Exception('No hangar_id found in document data');
+        }
+
+        // Process document proposals (forslag)
+        if (isset($dokumentStatus['dokforslag']['forslag']) && is_array($dokumentStatus['dokforslag']['forslag'])) {
+            $this->processForslag($hangarId, $dokumentStatus['dokforslag']['forslag']);
+        }
+
+        // Process document activities (aktivitet)
+        if (isset($dokumentStatus['dokaktivitet']['aktivitet']) && is_array($dokumentStatus['dokaktivitet']['aktivitet'])) {
+            $this->processAktiviteter($hangarId, $dokumentStatus['dokaktivitet']['aktivitet']);
+        }
+
+        // Process document interested parties (intressent)
+        if (isset($dokumentStatus['dokintressent']['intressent']) && is_array($dokumentStatus['dokintressent']['intressent'])) {
+            $this->processIntressenter($hangarId, $dokumentStatus['dokintressent']['intressent']);
+        }
+
+        // Process document information (uppgift)
+        if (isset($dokumentStatus['dokuppgift']['uppgift']) && is_array($dokumentStatus['dokuppgift']['uppgift'])) {
+            $this->processUppgifter($hangarId, $dokumentStatus['dokuppgift']['uppgift']);
+        }
+
+        // Process document attachments (bilaga)
+        if (isset($dokumentStatus['dokbilaga']['bilaga']) && is_array($dokumentStatus['dokbilaga']['bilaga'])) {
+            $this->processBilagor($hangarId, $dokumentStatus['dokbilaga']['bilaga']);
+        }
+
+        // Process document references (referens)
+        if (isset($dokumentStatus['dokreferens']['referens']) && is_array($dokumentStatus['dokreferens']['referens'])) {
+            $this->processReferenser($hangarId, $dokumentStatus['dokreferens']['referens']);
+        }
+    }
+
+    protected function importDokumentData($dokumentData)
+    {
+        $documents = isset($dokumentData['dokument']) ? $dokumentData['dokument'] : [];
+
+        // Handle both single document and array of documents
+        if (! is_array($documents) || (isset($documents['hangar_id']) && ! is_numeric(array_keys($documents)[0]))) {
+            $documents = [$documents];
+        }
+
+        foreach ($documents as $dokData) {
+            $this->processDokument($dokData);
+        }
+    }
+
+    protected function processDokument($dokData)
+    {
+        // Create main document
+        $dokument = Dokument::updateOrCreate(
+            ['dok_id' => $dokData['dok_id'] ?? null],
+            [
+                'hangar_id' => $dokData['hangar_id'] ?? null,
+                'rm' => $dokData['rm'] ?? null,
+                'beteckning' => $dokData['beteckning'] ?? null,
+                'typ' => $dokData['typ'] ?? null,
+                'subtyp' => $dokData['subtyp'] ?? null,
+                'doktyp' => $dokData['doktyp'] ?? null,
+                'typrubrik' => $dokData['typrubrik'] ?? null,
+                'dokumentnamn' => $dokData['dokumentnamn'] ?? null,
+                'debattnamn' => $dokData['debattnamn'] ?? null,
+                'tempbeteckning' => $dokData['tempbeteckning'] ?? null,
+                'organ' => $dokData['organ'] ?? null,
+                'mottagare' => $dokData['mottagare'] ?? null,
+                'nummer' => $dokData['nummer'] ?? null,
+                'slutnummer' => $dokData['slutnummer'] ?? null,
+                'datum' => isset($dokData['datum']) ? $this->parseDate($dokData['datum']) : null,
+                'systemdatum' => isset($dokData['systemdatum']) ? $this->parseDate($dokData['systemdatum']) : null,
+                'publicerad' => isset($dokData['publicerad']) ? $this->parseDate($dokData['publicerad']) : null,
+                'titel' => $dokData['titel'] ?? null,
+                'subtitel' => $dokData['subtitel'] ?? null,
+                'status' => $dokData['status'] ?? null,
+                'htmlformat' => $dokData['htmlformat'] ?? null,
+                'relaterat_id' => $dokData['relaterat_id'] ?? null,
+                'source' => $dokData['source'] ?? null,
+                'sourceid' => $dokData['sourceid'] ?? null,
+                'dokument_url_text' => $dokData['dokument_url_text'] ?? null,
+                'dokument_url_html' => $dokData['dokument_url_html'] ?? null,
+                'dokumentstatus_url_xml' => $dokData['dokumentstatus_url_xml'] ?? null,
+                'utskottsforslag_url_xml' => $dokData['utskottsforslag_url_xml'] ?? null,
+            ]
+        );
+
+        // Process related data
+        if (isset($dokData['aktivitet']) && is_array($dokData['aktivitet'])) {
+            $this->processAktiviteter($dokument->hangar_id, $dokData['aktivitet']);
+        }
+
+        if (isset($dokData['intressent']) && is_array($dokData['intressent'])) {
+            $this->processIntressenter($dokument->hangar_id, $dokData['intressent']);
+        }
+
+        if (isset($dokData['bilaga']) && is_array($dokData['bilaga'])) {
+            $this->processBilagor($dokument->hangar_id, $dokData['bilaga']);
+        }
+
+        if (isset($dokData['forslag']) && is_array($dokData['forslag'])) {
+            $this->processForslag($dokument->hangar_id, $dokData['forslag']);
+        }
+
+        if (isset($dokData['uppgift']) && is_array($dokData['uppgift'])) {
+            $this->processUppgifter($dokument->hangar_id, $dokData['uppgift']);
+        }
+
+        if (isset($dokData['referens']) && is_array($dokData['referens'])) {
+            $this->processReferenser($dokument->hangar_id, $dokData['referens']);
+        }
+    }
+
+    protected function processAktiviteter($hangarId, $aktiviteter)
+    {
+        foreach ($aktiviteter as $aktivitet) {
+            DokAktivitet::updateOrCreate(
+                [
+                    'hangar_id' => $hangarId,
+                    'kod' => $aktivitet['kod'] ?? null,
+                    'datum' => isset($aktivitet['datum']) ? $this->parseDate($aktivitet['datum']) : null,
+                ],
+                [
+                    'namn' => $aktivitet['namn'] ?? null,
+                    'status' => $aktivitet['status'] ?? null,
+                    'ordning' => $aktivitet['ordning'] ?? null,
+                    'process' => $aktivitet['process'] ?? null,
+                ]
+            );
+        }
+    }
+
+    protected function processIntressenter($hangarId, $intressenter)
+    {
+        foreach ($intressenter as $intressent) {
+            dump($intressent);
+            DokIntressent::updateOrCreate(
+                [
+                    'hangar_id' => $hangarId,
+                    'intressent_id' => $intressent['intressent_id'] ?? null,
+                ],
+                [
+                    'namn' => $intressent['namn'] ?? null,
+                    'partibet' => $intressent['partibet'] ?? null,
+                    'ordning' => $intressent['ordning'] ?? null,
+                    'roll' => $intressent['roll'] ?? null,
+                ]
+            );
+        }
+    }
+
+    protected function processBilagor($hangarId, $bilagor)
+    {
+        foreach ($bilagor as $bilaga) {
+            DokBilaga::updateOrCreate(
+                [
+                    'hangar_id' => $hangarId,
+                    'dok_id' => $bilaga['dok_id'] ?? null,
+                    'filnamn' => $bilaga['filnamn'] ?? null,
+                ],
+                [
+                    'titel' => $bilaga['titel'] ?? null,
+                    'subtitel' => $bilaga['subtitel'] ?? null,
+                    'filstorlek' => $bilaga['filstorlek'] ?? null,
+                    'filtyp' => $bilaga['filtyp'] ?? null,
+                    'fil_url' => $bilaga['fil_url'] ?? null,
+                ]
+            );
+        }
+    }
+
+    protected function processForslag($hangarId, $forslag)
+    {
+        foreach ($forslag as $forslagItem) {
+            DokForslag::updateOrCreate(
+                [
+                    'hangar_id' => $hangarId,
+                    'nummer' => $forslagItem['nummer'] ?? null,
+                ],
+                [
+                    'beteckning' => $forslagItem['beteckning'] ?? null,
+                    'lydelse' => $forslagItem['lydelse'] ?? null,
+                    'lydelse2' => $forslagItem['lydelse2'] ?? null,
+                    'utskottet' => $forslagItem['utskottet'] ?? null,
+                    'kammaren' => $forslagItem['kammaren'] ?? null,
+                    'behandlas_i' => $forslagItem['behandlas_i'] ?? null,
+                    'behandlas_i_punkt' => $forslagItem['behandlas_i_punkt'] ?? null,
+                    'kammarbeslutstyp' => $forslagItem['kammarbeslutstyp'] ?? null,
+                    'intressent' => $forslagItem['intressent'] ?? null,
+                    'avsnitt' => $forslagItem['avsnitt'] ?? null,
+                    'grundforfattning' => $forslagItem['grundforfattning'] ?? null,
+                    'andringsforfattning' => $forslagItem['andringsforfattning'] ?? null,
+                ]
+            );
+        }
+    }
+
+    protected function processUppgifter($hangarId, $uppgifter)
+    {
+        foreach ($uppgifter as $uppgift) {
+            DokUppgift::updateOrCreate(
+                [
+                    'hangar_id' => $hangarId,
+                    'kod' => $uppgift['kod'] ?? null,
+                ],
+                [
+                    'namn' => $uppgift['namn'] ?? null,
+                    'text' => $uppgift['text'] ?? null,
+                    'dok_id' => $uppgift['dok_id'] ?? null,
+                    'systemdatum' => isset($uppgift['systemdatum']) ? $this->parseDate($uppgift['systemdatum']) : null,
+                ]
+            );
+        }
+    }
+
+    protected function processReferenser($hangarId, $referenser)
+    {
+        foreach ($referenser as $referens) {
+            DokReferens::updateOrCreate(
+                [
+                    'hangar_id' => $hangarId,
+                    'referenstyp' => $referens['referenstyp'] ?? null,
+                    'ref_dok_id' => $referens['ref_dok_id'] ?? null,
+                ],
+                [
+                    'uppgift' => $referens['uppgift'] ?? null,
+                    'ref_dok_typ' => $referens['ref_dok_typ'] ?? null,
+                    'ref_dok_rm' => $referens['ref_dok_rm'] ?? null,
+                    'ref_dok_bet' => $referens['ref_dok_bet'] ?? null,
+                    'ref_dok_titel' => $referens['ref_dok_titel'] ?? null,
+                    'ref_dok_subtitel' => $referens['ref_dok_subtitel'] ?? null,
+                    'ref_dok_subtyp' => $referens['ref_dok_subtyp'] ?? null,
+                    'ref_dok_dokumentnamn' => $referens['ref_dok_dokumentnamn'] ?? null,
+                ]
+            );
+        }
+    }
+
+    protected function importPersonData($personData)
+    {
+        $persons = isset($personData['person']) ? $personData['person'] : [];
+
+        // Handle both single person and array of persons
+        if (! is_array($persons) || (isset($persons['intressent_id']) && ! is_numeric(array_keys($persons)[0]))) {
+            $persons = [$persons];
+        }
+
+        foreach ($persons as $personInfo) {
+            $this->processPerson($personInfo);
+        }
+    }
+
+    protected function processPerson($personInfo)
+    {
+        $person = Person::updateOrCreate(
+            ['intressent_id' => $personInfo['intressent_id'] ?? null],
+            [
+                'född_år' => $personInfo['fodd_ar'] ?? $personInfo['född_år'] ?? null,
+                'kön' => $personInfo['kon'] ?? $personInfo['kön'] ?? null,
+                'efternamn' => $personInfo['efternamn'] ?? null,
+                'tilltalsnamn' => $personInfo['tilltalsnamn'] ?? null,
+                'sorteringsnamn' => $personInfo['sorteringsnamn'] ?? null,
+                'iort' => $personInfo['iort'] ?? null,
+                'parti' => $personInfo['parti'] ?? null,
+                'valkrets' => $personInfo['valkrets'] ?? null,
+                'status' => $personInfo['status'] ?? null,
+            ]
+        );
+
+        // Process person assignments
+        if (isset($personInfo['personuppdrag']['uppdrag']) && is_array($personInfo['personuppdrag']['uppdrag'])) {
+            $this->processPersonUppdrag($person->intressent_id, $personInfo['personuppdrag']['uppdrag']);
+        }
+
+        // Process person information
+        if (isset($personInfo['personuppgift']['uppgift']) && is_array($personInfo['personuppgift']['uppgift'])) {
+            $this->processPersonUppgift($person->intressent_id, $personInfo['personuppgift']['uppgift']);
+        }
+    }
+
+    protected function processPersonUppdrag($intressentId, $uppdragList)
+    {
+        foreach ($uppdragList as $uppdrag) {
+            PersonUppdrag::updateOrCreate(
+                [
+                    'intressent_id' => $intressentId,
+                    'organ_kod' => $uppdrag['organ_kod'] ?? null,
+                    'roll_kod' => $uppdrag['roll_kod'] ?? null,
+                    'ordningsnummer' => $uppdrag['ordningsnummer'] ?? null,
+                ],
+                [
+                    'status' => $uppdrag['status'] ?? null,
+                    'typ' => $uppdrag['typ'] ?? null,
+                    'from' => isset($uppdrag['from']) ? $this->parseDate($uppdrag['from']) : null,
+                    'tom' => isset($uppdrag['tom']) ? $this->parseDate($uppdrag['tom']) : null,
+                    'uppgift' => $uppdrag['uppgift'] ?? null,
+                ]
+            );
+        }
+    }
+
+    protected function processPersonUppgift($intressentId, $uppgiftList)
+    {
+        foreach ($uppgiftList as $uppgift) {
+            PersonUppgift::updateOrCreate(
+                [
+                    'intressent_id' => $intressentId,
+                    'uppgift_kod' => $uppgift['kod'] ?? null,
+                ],
+                [
+                    'uppgift' => $uppgift['uppgift'] ?? null,
+                    'uppgift_typ' => $uppgift['typ'] ?? null,
+                ]
+            );
+        }
+    }
+
+    protected function importOrganData($organData)
+    {
+        $organs = isset($organData['organ']) ? $organData['organ'] : [];
+
+        // Handle both single organ and array of organs
+        if (! is_array($organs) || (isset($organs['id']) && ! is_numeric(array_keys($organs)[0]))) {
+            $organs = [$organs];
+        }
+
+        foreach ($organs as $organInfo) {
+            Organ::updateOrCreate(
+                ['id' => $organInfo['id'] ?? null],
+                [
+                    'kod' => $organInfo['kod'] ?? null,
+                    'namn' => $organInfo['namn'] ?? null,
+                    'typ' => $organInfo['typ'] ?? null,
+                    'status' => $organInfo['status'] ?? null,
+                    'sortering' => $organInfo['sortering'] ?? null,
+                    'namn_en' => $organInfo['namn_en'] ?? null,
+                    'domän' => $organInfo['doman'] ?? $organInfo['domän'] ?? null,
+                    'beskrivning' => $organInfo['beskrivning'] ?? null,
+                ]
+            );
+        }
+    }
+
+    protected function importSingleDokument($dokument)
+    {
+        $this->processDokument($dokument);
+    }
+
+    protected function parseDate($dateString)
+    {
+        if (empty($dateString)) {
+            return null;
+        }
+
+        try {
+            return \Carbon\Carbon::parse($dateString);
+        } catch (\Exception $e) {
+            Log::warning("Could not parse date: {$dateString}");
+
+            return null;
+        }
+    }
+}

app/Livewire/Motion/Search.php

@@ -0,0 +1,146 @@
+<?php
+
+namespace App\Livewire\Motion;
+
+use App\Enums\Parties as PartyEnum;
+use App\Services\RiksdagenService;
+use Illuminate\Pagination\LengthAwarePaginator;
+use Illuminate\Support\Facades\Cache;
+use Livewire\Attributes\Computed;
+use Livewire\Attributes\Url;
+use Livewire\Component;
+use Livewire\WithPagination;
+
+class Search extends Component
+{
+    use WithPagination;
+
+    #[Url]
+    public $query = '';
+
+    #[Url]
+    public $party = '';
+
+    #[Url]
+    public $dateInterval = '';
+
+    private $paginator;
+
+    public $loading = false;
+
+    public function mount()
+    {
+        $this->searchMotions();
+    }
+
+    public function updatedQuery()
+    {
+        $this->resetPage();
+        $this->searchMotions();
+    }
+
+    public function updatedParty()
+    {
+        $this->resetPage();
+        $this->searchMotions();
+    }
+
+    public function updatedDateInterval()
+    {
+        $this->resetPage();
+        $this->searchMotions();
+    }
+
+    public function searchMotions()
+    {
+        if (empty($this->query) && empty($this->party) && empty($this->dateInterval)) {
+            $this->paginator = null;
+
+            return;
+        }
+
+        $this->loading = true;
+
+        $cacheKey = 'motions_'.md5($this->query.$this->party.$this->dateInterval.$this->getPage());
+
+        $result = Cache::remember($cacheKey, 60 * 5, function () {
+            return app(RiksdagenService::class)->searchMotions(
+                query: $this->query,
+                party: $this->party,
+                dateInterval: $this->dateInterval,
+                page: $this->getPage()
+            );
+        });
+
+        $motions = $result->original->dokumentlista->dokument ?? [];
+        $totalResults = (int) ($result->original->dokumentlista->{'@traffar'} ?? 0);
+        $perPage = 20; // Default items per page from Riksdag API
+        $currentPage = $this->getPage();
+
+        $this->paginator = new LengthAwarePaginator(
+            items: collect($motions),
+            total: $totalResults,
+            perPage: $perPage,
+            currentPage: $currentPage,
+            options: [
+                'path' => request()->url(),
+                'pageName' => 'page',
+            ]
+        );
+
+        $this->loading = false;
+    }
+
+    #[Computed()]
+    public function motions()
+    {
+        return $this->paginator ? collect($this->paginator->items()) : collect();
+    }
+
+    #[Computed()]
+    public function totalResults()
+    {
+        return $this->paginator ? $this->paginator->total() : 0;
+    }
+
+    public function clearFilters()
+    {
+        $this->query = '';
+        $this->party = '';
+        $this->dateInterval = '';
+        $this->resetPage();
+        $this->searchMotions();
+    }
+
+    #[Computed()]
+    public function parties()
+    {
+        return collect(PartyEnum::cases())->mapWithKeys(function ($party) {
+            return [$party->value => $party->label()];
+        });
+    }
+
+    #[Computed()]
+    public function dateIntervals()
+    {
+        return [
+            '2025/26' => '2025/26',
+            '2024/25' => '2024/25',
+            '2023/24' => '2023/24',
+            '2022/23' => '2022/23',
+            '2021/22' => '2021/22',
+            '2020/21' => '2020/21',
+            '2019/20' => '2019/20',
+            '2018/19' => '2018/19',
+        ];
+    }
+
+    public function render()
+    {
+        $this->searchMotions();
+
+        return view('livewire.motion.search', [
+            'paginatedMotions' => $this->paginator,
+        ])->title('Sök Motioner - Riksdagen App');
+    }
+}

app/Livewire/Motion/Show.php

@@ -0,0 +1,71 @@
+<?php
+
+namespace App\Livewire\Motion;
+
+use App\Services\RiksdagenService;
+use Illuminate\Support\Facades\Cache;
+use Livewire\Attributes\Computed;
+use Livewire\Component;
+
+class Show extends Component
+{
+    public $motionId;
+
+    public $motion;
+
+    private RiksdagenService $service;
+
+    public function mount($motionId)
+    {
+        $this->motionId = $motionId;
+        $this->service = app(RiksdagenService::class);
+
+        $result = Cache::remember('motion_'.$motionId, 24 * 60 * 60, function () use ($motionId) {
+            return $this->service->getMotion($motionId);
+        });
+
+        $this->motion = $result->original->dokumentlista->dokument[0] ?? null;
+    }
+
+    #[Computed()]
+    public function riksdagenUrl()
+    {
+        return 'https://www.riksdagen.se/sv/dokument-lagar/dokument/'.$this->motionId;
+    }
+
+    #[Computed()]
+    public function authors()
+    {
+        if (! $this->motion || ! isset($this->motion->dokintressent->intressent)) {
+            return collect();
+        }
+
+        $intressenter = $this->motion->dokintressent->intressent;
+        if (! is_array($intressenter)) {
+            $intressenter = [$intressenter];
+        }
+
+        return collect($intressenter)->where('roll', 'undertecknare');
+    }
+
+    #[Computed()]
+    public function attachments()
+    {
+        if (! $this->motion || ! isset($this->motion->filbilaga->fil)) {
+            return collect();
+        }
+
+        $files = $this->motion->filbilaga->fil;
+        if (! is_array($files)) {
+            $files = [$files];
+        }
+
+        return collect($files);
+    }
+
+    public function render()
+    {
+        return view('livewire.motion.show')
+            ->title(($this->motion->titel ?? 'Motion').' - Riksdagen App');
+    }
+}

app/Livewire/Person/Search.php

@@ -2,30 +2,35 @@
 
 namespace App\Livewire\Person;
 
-use Livewire\Component;
-use App\Services\RiksdagenService;
 use App\Enums\Parties;
+use App\Services\RiksdagenService;
+use Livewire\Component;
 
 class Search extends Component
 {
     public $firstName = '';
+
     public $lastName = '';
+
     public $party = '';
+
     public $results = [];
+
     public $parties = [];
 
     public function mount()
     {
-        $this->parties = collect(Parties::cases())->sortBy(fn($party) => $party->label())->toArray();
+        $this->parties = collect(Parties::cases())->sortBy(fn ($party) => $party->label())->toArray();
     }
 
     public function search()
     {
         $service = app(RiksdagenService::class);
+
         $this->results = $service->searchPerson(
             firstName: $this->firstName,
             lastName: $this->lastName,
-            party: $this->party
+            party: $this->party,
         )->original;
     }
 

app/Livewire/Person/Show.php

@@ -2,11 +2,12 @@
 
 namespace App\Livewire\Person;
 
-use Livewire\Component;
 use App\Services\RiksdagenService;
-use Livewire\Attributes\Computed;
 use Asantibanez\LivewireCharts\Models\PieChartModel;
+use Illuminate\Support\Facades\Cache;
+use Livewire\Attributes\Computed;
 use Livewire\Attributes\Lazy;
+use Livewire\Component;
 
 #[Lazy()]
 class Show extends Component
@@ -17,9 +18,15 @@ class Show extends Component
 
     public $votes = [];
 
+    public $motions = [];
+
     public $votesByYear = [];
 
-    public $selectedYear;
+    public $motionsByYear = [];
+
+    public $votesSelectedYear;
+
+    public $motionsSelectedYear;
 
     public $selectedUppdragTab = 'current';
 
@@ -27,47 +34,87 @@ class Show extends Component
 
     public $previousUppdrag = [];
 
+    private RiksdagenService $service;
+
     public function mount($personId)
     {
         $this->personId = $personId;
-        $service = app(RiksdagenService::class);
+        $this->service = app(RiksdagenService::class);
-        $result = $service->searchPerson(mp_id: $personId);
+        $result = Cache::remember('person_'.$personId, 24 * 60 * 60, function () use ($personId) {
+            return $this->service->searchPerson(mp_id: $personId);
+        });
         $this->person = $result->original->personlista->person ?? null;
 
         $this->getPersonVotes();
+        $this->getPersonMotions();
         $this->groupUppdrag();
     }
 
     #[Computed()]
     public function riksdagenUrl()
     {
-        return "https://www.riksdagen.se/sv/ledamoter-partier/ledamot/" . $this->person->tilltalsnamn . "-" . $this->person->efternamn . "_" . $this->personId;
+        return 'https://www.riksdagen.se/sv/ledamoter-partier/ledamot/'.$this->person->tilltalsnamn.'-'.$this->person->efternamn.'_'.$this->personId;
     }
 
     public function getPersonVotes()
     {
-        $service = app(RiksdagenService::class);
+        $result = Cache::remember('person_votes_'.$this->personId, 24 * 60 * 60, function () {
-        $result = $service->searchVotes(mp_id: $this->personId);
+            return $this->service->searchVotes(mp_id: $this->personId);
+        });
+
         $votesList = $result->original->voteringlista->votering ?? [];
 
-        // Group votes by year (from rm field like 2025/26)
+        // Group votes by "rm" field (e.g., 2024/25)
         foreach ($votesList as $vote) {
-            $year = explode('/', $vote->rm)[0]; // Extract year from rm like "2025/26"
+            $rm = $vote->rm;
-            if (!isset($this->votesByYear[$year])) {
+            if (! isset($this->votesByYear[$rm])) {
-                $this->votesByYear[$year] = [];
+                $this->votesByYear[$rm] = [];
             }
-            $this->votesByYear[$year][] = $vote;
+            $this->votesByYear[$rm][] = $vote;
         }
 
         // Set default selected year to the most recent
-        if (!empty($this->votesByYear)) {
+        if (! empty($this->votesByYear)) {
-            $this->selectedYear = max(array_keys($this->votesByYear));
+            // Sort keys as strings (e.g., 2024/25, 2023/24, ...)
+            $years = array_keys($this->votesByYear);
+            rsort($years, SORT_STRING);
+            $this->votesSelectedYear = $years[0];
         }
     }
 
-    public function selectYear($year)
+    public function getPersonMotions()
     {
-        $this->selectedYear = $year;
+        $result = Cache::remember('person_motions_'.$this->personId, 24 * 60 * 60, function () {
+            return $this->service->getPersonMotions(mp_id: $this->personId);
+        });
+        $motionsList = $result->original->dokumentlista->dokument ?? [];
+
+        // Group votes by "rm" field (e.g., 2024/25)
+        foreach ($motionsList as $motion) {
+            $rm = $motion->rm;
+            if (! isset($this->motionsByYear[$rm])) {
+                $this->motionsByYear[$rm] = [];
+            }
+            $this->motionsByYear[$rm][] = $motion;
+        }
+
+        // Set default selected year to the most recent
+        if (! empty($this->motionsByYear)) {
+            // Sort keys as strings (e.g., 2024/25, 2023/24, ...)
+            $years = array_keys($this->motionsByYear);
+            rsort($years, SORT_STRING);
+            $this->motionsSelectedYear = $years[0];
+        }
+    }
+
+    public function selectVotesYear($year)
+    {
+        $this->votesSelectedYear = $year;
+    }
+
+    public function selectMotionsYear($year)
+    {
+        $this->motionsSelectedYear = $year;
     }
 
     public function selectUppdragTab($tab)
@@ -77,7 +124,7 @@ class Show extends Component
 
     public function groupUppdrag()
     {
-        if (!$this->person || !isset($this->person->personuppdrag->uppdrag)) {
+        if (! $this->person || ! isset($this->person->personuppdrag->uppdrag)) {
             return;
         }
 
@@ -98,11 +145,11 @@ class Show extends Component
         }
 
         // Sort by date (most recent first)
-        usort($this->currentUppdrag, function($a, $b) {
+        usort($this->currentUppdrag, function ($a, $b) {
             return \Carbon\Carbon::parse($b->from)->timestamp - \Carbon\Carbon::parse($a->from)->timestamp;
         });
 
-        usort($this->previousUppdrag, function($a, $b) {
+        usort($this->previousUppdrag, function ($a, $b) {
             return \Carbon\Carbon::parse($b->tom ?: $b->from)->timestamp - \Carbon\Carbon::parse($a->tom ?: $a->from)->timestamp;
         });
     }
@@ -110,16 +157,16 @@ class Show extends Component
     #[Computed()]
     public function votingStatistics()
     {
-        if (!$this->selectedYear || !isset($this->votesByYear[$this->selectedYear])) {
+        if (! $this->votesSelectedYear || ! isset($this->votesByYear[$this->votesSelectedYear])) {
             return [];
         }
 
-        $votes = $this->votesByYear[$this->selectedYear];
+        $votes = $this->votesByYear[$this->votesSelectedYear];
         $statistics = [];
 
         foreach ($votes as $vote) {
             $voteType = $vote->rost;
-            if (!isset($statistics[$voteType])) {
+            if (! isset($statistics[$voteType])) {
                 $statistics[$voteType] = 0;
             }
             $statistics[$voteType]++;
@@ -133,8 +180,8 @@ class Show extends Component
     {
         $statistics = $this->votingStatistics;
 
-        $pieChart = (new PieChartModel())
+        $pieChart = (new PieChartModel)
-            ->setTitle('Voteringsstatistik för ' . $this->selectedYear)
+            ->setTitle('Voteringsstatistik för '.$this->votesSelectedYear)
             ->setAnimated(true)
             ->withDataLabels();
 

app/Models/Anforande.php

@@ -0,0 +1,20 @@
+<?php
+namespace App\Models;
+
+use Illuminate\Database\Eloquent\Model;
+
+class Anforande extends Model
+{
+    protected $table = 'anforande';
+    public $timestamps = false;
+
+    public function dokument()
+    {
+        return $this->belongsTo(Dokument::class, 'dok_hangar_id', 'hangar_id');
+    }
+
+    public function person()
+    {
+        return $this->belongsTo(Person::class, 'intressent_id', 'intressent_id');
+    }
+}

app/Models/Debatt.php

@@ -0,0 +1,20 @@
+<?php
+namespace App\Models;
+
+use Illuminate\Database\Eloquent\Model;
+
+class Debatt extends Model
+{
+    protected $table = 'debatt';
+    public $timestamps = false;
+
+    public function dokument()
+    {
+        return $this->belongsTo(Dokument::class, 'hangar_id', 'hangar_id');
+    }
+
+    public function person()
+    {
+        return $this->belongsTo(Person::class, 'intressent_id', 'intressent_id');
+    }
+}

app/Models/DokAktivitet.php

@@ -0,0 +1,27 @@
+<?php
+
+namespace App\Models;
+
+use Illuminate\Database\Eloquent\Model;
+
+class DokAktivitet extends Model
+{
+    protected $table = 'dokaktivitet';
+
+    public $timestamps = false;
+
+    protected $fillable = [
+        'hangar_id',
+        'kod',
+        'datum',
+        'namn',
+        'status',
+        'ordning',
+        'process',
+    ];
+
+    public function dokument()
+    {
+        return $this->belongsTo(Dokument::class, 'hangar_id', 'hangar_id');
+    }
+}

app/Models/DokBilaga.php

@@ -0,0 +1,28 @@
+<?php
+
+namespace App\Models;
+
+use Illuminate\Database\Eloquent\Model;
+
+class DokBilaga extends Model
+{
+    protected $table = 'dokbilaga';
+
+    public $timestamps = false;
+
+    protected $fillable = [
+        'hangar_id',
+        'dok_id',
+        'filnamn',
+        'titel',
+        'subtitel',
+        'filstorlek',
+        'filtyp',
+        'fil_url',
+    ];
+
+    public function dokument()
+    {
+        return $this->belongsTo(Dokument::class, 'hangar_id', 'hangar_id');
+    }
+}

app/Models/DokForslag.php

@@ -0,0 +1,34 @@
+<?php
+
+namespace App\Models;
+
+use Illuminate\Database\Eloquent\Model;
+
+class DokForslag extends Model
+{
+    protected $table = 'dokforslag';
+
+    public $timestamps = false;
+
+    protected $fillable = [
+        'hangar_id',
+        'nummer',
+        'beteckning',
+        'lydelse',
+        'lydelse2',
+        'utskottet',
+        'kammaren',
+        'behandlas_i',
+        'behandlas_i_punkt',
+        'kammarbeslutstyp',
+        'intressent',
+        'avsnitt',
+        'grundforfattning',
+        'andringsforfattning',
+    ];
+
+    public function dokument()
+    {
+        return $this->belongsTo(Dokument::class, 'hangar_id', 'hangar_id');
+    }
+}

app/Models/DokIntressent.php

@@ -0,0 +1,31 @@
+<?php
+
+namespace App\Models;
+
+use Illuminate\Database\Eloquent\Model;
+
+class DokIntressent extends Model
+{
+    protected $table = 'dokintressent';
+
+    public $timestamps = false;
+
+    protected $fillable = [
+        'hangar_id',
+        'intressent_id',
+        'namn',
+        'partibet',
+        'ordning',
+        'roll',
+    ];
+
+    public function dokument()
+    {
+        return $this->belongsTo(Dokument::class, 'hangar_id', 'hangar_id');
+    }
+
+    public function person()
+    {
+        return $this->belongsTo(Person::class, 'intressent_id', 'intressent_id');
+    }
+}

app/Models/DokMotforslag.php

@@ -0,0 +1,15 @@
+<?php
+namespace App\Models;
+
+use Illuminate\Database\Eloquent\Model;
+
+class DokMotforslag extends Model
+{
+    protected $table = 'dokmotforslag';
+    public $timestamps = false;
+
+    public function dokument()
+    {
+        return $this->belongsTo(Dokument::class, 'hangar_id', 'hangar_id');
+    }
+}

app/Models/DokReferens.php

@@ -0,0 +1,31 @@
+<?php
+
+namespace App\Models;
+
+use Illuminate\Database\Eloquent\Model;
+
+class DokReferens extends Model
+{
+    protected $table = 'dokreferens';
+
+    public $timestamps = false;
+
+    protected $fillable = [
+        'hangar_id',
+        'referenstyp',
+        'ref_dok_id',
+        'uppgift',
+        'ref_dok_typ',
+        'ref_dok_rm',
+        'ref_dok_bet',
+        'ref_dok_titel',
+        'ref_dok_subtitel',
+        'ref_dok_subtyp',
+        'ref_dok_dokumentnamn',
+    ];
+
+    public function dokument()
+    {
+        return $this->belongsTo(Dokument::class, 'hangar_id', 'hangar_id');
+    }
+}

app/Models/DokUppgift.php

@@ -0,0 +1,30 @@
+<?php
+
+namespace App\Models;
+
+use Illuminate\Database\Eloquent\Model;
+
+class DokUppgift extends Model
+{
+    protected $table = 'dokuppgift';
+
+    public $timestamps = false;
+
+    protected $fillable = [
+        'hangar_id',
+        'kod',
+        'namn',
+        'text',
+        'dok_id',
+        'systemdatum',
+    ];
+
+    protected $casts = [
+        'systemdatum' => 'datetime',
+    ];
+
+    public function dokument()
+    {
+        return $this->belongsTo(Dokument::class, 'hangar_id', 'hangar_id');
+    }
+}

app/Models/DokUtskottsforslag.php

@@ -0,0 +1,15 @@
+<?php
+namespace App\Models;
+
+use Illuminate\Database\Eloquent\Model;
+
+class DokUtskottsforslag extends Model
+{
+    protected $table = 'dokutskottsforslag';
+    public $timestamps = false;
+
+    public function dokument()
+    {
+        return $this->belongsTo(Dokument::class, 'hangar_id', 'hangar_id');
+    }
+}

app/Models/Dokument.php

@@ -0,0 +1,102 @@
+<?php
+
+namespace App\Models;
+
+use Illuminate\Database\Eloquent\Model;
+
+class Dokument extends Model
+{
+    protected $table = 'dokument';
+
+    protected $primaryKey = 'hangar_id';
+
+    public $timestamps = false;
+
+    protected $fillable = [
+        'hangar_id',
+        'dok_id',
+        'rm',
+        'beteckning',
+        'typ',
+        'subtyp',
+        'doktyp',
+        'typrubrik',
+        'dokumentnamn',
+        'debattnamn',
+        'tempbeteckning',
+        'organ',
+        'mottagare',
+        'nummer',
+        'slutnummer',
+        'datum',
+        'systemdatum',
+        'publicerad',
+        'titel',
+        'subtitel',
+        'status',
+        'htmlformat',
+        'relaterat_id',
+        'source',
+        'sourceid',
+        'dokument_url_text',
+        'dokument_url_html',
+        'dokumentstatus_url_xml',
+        'utskottsforslag_url_xml',
+        'html',
+    ];
+
+    public function utskottsforslag()
+    {
+        return $this->hasMany(DokUtskottsforslag::class, 'hangar_id', 'hangar_id');
+    }
+
+    public function motforslag()
+    {
+        return $this->hasMany(DokMotforslag::class, 'hangar_id', 'hangar_id');
+    }
+
+    public function aktiviteter()
+    {
+        return $this->hasMany(DokAktivitet::class, 'hangar_id', 'hangar_id');
+    }
+
+    public function intressenter()
+    {
+        return $this->hasMany(DokIntressent::class, 'hangar_id', 'hangar_id');
+    }
+
+    public function forslag()
+    {
+        return $this->hasMany(DokForslag::class, 'hangar_id', 'hangar_id');
+    }
+
+    public function uppgifter()
+    {
+        return $this->hasMany(DokUppgift::class, 'hangar_id', 'hangar_id');
+    }
+
+    public function bilagor()
+    {
+        return $this->hasMany(DokBilaga::class, 'hangar_id', 'hangar_id');
+    }
+
+    public function referenser()
+    {
+        return $this->hasMany(DokReferens::class, 'hangar_id', 'hangar_id');
+    }
+
+    public function debatter()
+    {
+        return $this->hasMany(Debatt::class, 'hangar_id', 'hangar_id');
+    }
+
+    public function voteringar()
+    {
+        return $this->hasMany(Votering::class, 'hangar_id', 'hangar_id');
+    }
+
+    public function anforanden()
+    {
+        return $this->hasMany(Anforande::class, 'dok_hangar_id', 'hangar_id');
+    }
+}

app/Models/Organ.php

@@ -0,0 +1,31 @@
+<?php
+
+namespace App\Models;
+
+use Illuminate\Database\Eloquent\Model;
+
+class Organ extends Model
+{
+    protected $table = 'organ';
+
+    protected $primaryKey = 'id';
+
+    public $timestamps = false;
+
+    protected $fillable = [
+        'id',
+        'kod',
+        'namn',
+        'typ',
+        'status',
+        'sortering',
+        'namn_en',
+        'domän',
+        'beskrivning',
+    ];
+
+    public function personUppdrag()
+    {
+        return $this->hasMany(PersonUppdrag::class, 'organ_kod', 'kod');
+    }
+}

app/Models/Person.php

@@ -0,0 +1,61 @@
+<?php
+
+namespace App\Models;
+
+use Illuminate\Database\Eloquent\Model;
+
+class Person extends Model
+{
+    protected $table = 'person';
+
+    protected $primaryKey = 'intressent_id';
+
+    protected $keyType = 'string';
+
+    public $incrementing = false;
+
+    public $timestamps = false;
+
+    protected $fillable = [
+        'intressent_id',
+        'född_år',
+        'kön',
+        'efternamn',
+        'tilltalsnamn',
+        'sorteringsnamn',
+        'iort',
+        'parti',
+        'valkrets',
+        'status',
+    ];
+
+    public function uppdrag()
+    {
+        return $this->hasMany(PersonUppdrag::class, 'intressent_id', 'intressent_id');
+    }
+
+    public function uppgifter()
+    {
+        return $this->hasMany(PersonUppgift::class, 'intressent_id', 'intressent_id');
+    }
+
+    public function voteringar()
+    {
+        return $this->hasMany(Votering::class, 'intressent_id', 'intressent_id');
+    }
+
+    public function anforanden()
+    {
+        return $this->hasMany(Anforande::class, 'intressent_id', 'intressent_id');
+    }
+
+    public function debatter()
+    {
+        return $this->hasMany(Debatt::class, 'intressent_id', 'intressent_id');
+    }
+
+    public function dokIntressenter()
+    {
+        return $this->hasMany(DokIntressent::class, 'intressent_id', 'intressent_id');
+    }
+}

app/Models/PersonUppdrag.php

@@ -0,0 +1,44 @@
+<?php
+
+namespace App\Models;
+
+use Illuminate\Database\Eloquent\Model;
+
+class PersonUppdrag extends Model
+{
+    protected $table = 'personuppdrag';
+
+    public $timestamps = false;
+
+    protected $fillable = [
+        'intressent_id',
+        'organ_kod',
+        'roll_kod',
+        'ordningsnummer',
+        'status',
+        'typ',
+        'from',
+        'tom',
+        'uppgift',
+    ];
+
+    protected $casts = [
+        'from' => 'datetime',
+        'tom' => 'datetime',
+    ];
+
+    public function person()
+    {
+        return $this->belongsTo(Person::class, 'intressent_id', 'intressent_id');
+    }
+
+    public function organ()
+    {
+        return $this->belongsTo(Organ::class, 'organ_kod', 'kod');
+    }
+
+    public function roll()
+    {
+        return $this->belongsTo(Roll::class, 'roll_kod', 'kod');
+    }
+}

app/Models/PersonUppgift.php

@@ -0,0 +1,24 @@
+<?php
+
+namespace App\Models;
+
+use Illuminate\Database\Eloquent\Model;
+
+class PersonUppgift extends Model
+{
+    protected $table = 'personuppgift';
+
+    public $timestamps = false;
+
+    protected $fillable = [
+        'intressent_id',
+        'uppgift_kod',
+        'uppgift',
+        'uppgift_typ',
+    ];
+
+    public function person()
+    {
+        return $this->belongsTo(Person::class, 'intressent_id', 'intressent_id');
+    }
+}

app/Models/Planering.php

@@ -0,0 +1,31 @@
+<?php
+namespace App\Models;
+
+use Illuminate\Database\Eloquent\Model;
+
+class Planering extends Model
+{
+    protected $table = 'planering';
+    protected $primaryKey = 'nyckel';
+    public $timestamps = false;
+
+    protected $casts = [
+        'datum' => 'datetime',
+        'publicerad' => 'datetime',
+        'uppdaterad' => 'datetime',
+        'wn_expires' => 'datetime',
+        'timestamp' => 'datetime',
+        'slutdatum' => 'datetime',
+        'webbtvlive' => 'boolean',
+    ];
+
+    public function person()
+    {
+        return $this->belongsTo(Person::class, 'intressent_id', 'intressent_id');
+    }
+
+    public function mottagare()
+    {
+        return $this->belongsTo(Person::class, 'mottagare_id', 'intressent_id');
+    }
+}

app/Models/Riksmote.php

@@ -0,0 +1,16 @@
+<?php
+namespace App\Models;
+
+use Illuminate\Database\Eloquent\Model;
+
+class Riksmote extends Model
+{
+    protected $table = 'riksmote';
+    protected $primaryKey = 'pk';
+    public $timestamps = false;
+
+    protected $casts = [
+        'start' => 'datetime',
+        'slut' => 'datetime',
+    ];
+}

app/Models/Roll.php

@@ -0,0 +1,16 @@
+<?php
+namespace App\Models;
+
+use Illuminate\Database\Eloquent\Model;
+
+class Roll extends Model
+{
+    protected $table = 'roll';
+    protected $primaryKey = 'pk';
+    public $timestamps = false;
+
+    public function personUppdrag()
+    {
+        return $this->hasMany(PersonUppdrag::class, 'roll_kod', 'kod');
+    }
+}

app/Models/Votering.php

@@ -0,0 +1,20 @@
+<?php
+namespace App\Models;
+
+use Illuminate\Database\Eloquent\Model;
+
+class Votering extends Model
+{
+    protected $table = 'votering';
+    public $timestamps = false;
+
+    public function dokument()
+    {
+        return $this->belongsTo(Dokument::class, 'hangar_id', 'hangar_id');
+    }
+
+    public function person()
+    {
+        return $this->belongsTo(Person::class, 'intressent_id', 'intressent_id');
+    }
+}

app/Services/RiksdagenService.php

@@ -30,8 +30,8 @@ class RiksdagenService
                 'enamn' => $lastName,
                 'utformat' => 'json',
                 'sort' => 'sorteringsnamn',
-                'sortorder' => 'asc'
+                'sortorder' => 'asc',
-            ]
+            ],
         ])->getBody()->getContents();
 
         $data = json_decode($response);
@@ -50,8 +50,86 @@ class RiksdagenService
                 'rm' => $date,
                 'parti' => $party,
                 'utformat' => 'json',
-                'sz' => '500',
+                'sz' => '3000',
-            ]
+            ],
+        ])->getBody()->getContents();
+
+        $data = json_decode($response);
+
+        return response()->json($data);
+    }
+
+    public function getPersonMotions(
+        string $mp_id,
+        string $date = '',
+    ): JsonResponse {
+        $response = $this->http->get('dokumentlista/', [
+            'query' => [
+                'iid' => $mp_id,
+                'rm' => $date,
+                'doktyp' => 'mot',
+                'utformat' => 'json',
+            ],
+        ])->getBody()->getContents();
+
+        $data = json_decode($response);
+
+        return response()->json($data);
+    }
+
+    public function getPartyMotions(
+        string $party,
+        string $date = '',
+
+    ): JsonResponse {
+        $response = $this->http->get('dokumentlista/', [
+            'query' => [
+                'parti' => $party,
+                'rm' => $date,
+                'doktyp' => 'mot',
+                'utformat' => 'json',
+            ],
+        ])->getBody()->getContents();
+
+        $data = json_decode($response);
+
+        return response()->json($data);
+    }
+
+    public function searchMotions(
+        string $query = '',
+        string $party = '',
+        string $dateInterval = '',
+        int $page = 1
+    ): JsonResponse {
+        $response = $this->http->get('dokumentlista/', [
+            'query' => array_filter([
+                'sok' => $query,
+                'parti' => $party,
+                'rm' => $dateInterval,
+                'doktyp' => 'mot',
+                'utformat' => 'json',
+                'p' => $page,
+            ]),
+        ])->getBody()->getContents();
+
+        $data = json_decode($response);
+
+        return response()->json($data);
+    }
+
+    public function getMotion(
+        string $bet,
+        string $tempbet,
+        string $nr,
+    ): JsonResponse {
+        $response = $this->http->get('dokumentlista/', [
+            'query' => [
+                'bet' => $bet,
+                'tempbet' => $tempbet,
+                'nr' => $nr,
+                'utformat' => 'json',
+            ],
         ])->getBody()->getContents();
 
         $data = json_decode($response);

database/migrations/2025_12_27_000000_create_riksdagen_tables.php

@@ -0,0 +1,340 @@
+<?php
+
+use Illuminate\Database\Migrations\Migration;
+use Illuminate\Database\Schema\Blueprint;
+use Illuminate\Support\Facades\Schema;
+
+return new class extends Migration
+{
+    public function up()
+    {
+        // dokument
+        Schema::create('dokument', function (Blueprint $table) {
+            $table->integer('hangar_id');
+            $table->string('dok_id');
+            $table->string('rm');
+            $table->string('beteckning')->nullable();
+            $table->string('typ')->nullable();
+            $table->string('subtyp')->nullable();
+            $table->string('doktyp')->nullable();
+            $table->string('typrubrik')->nullable();
+            $table->string('dokumentnamn')->nullable();
+            $table->string('debattnamn')->nullable();
+            $table->string('tempbeteckning')->nullable();
+            $table->string('organ')->nullable();
+            $table->string('mottagare')->nullable();
+            $table->integer('nummer')->nullable();
+            $table->integer('slutnummer')->nullable();
+            $table->dateTime('datum')->nullable();
+            $table->dateTime('systemdatum')->nullable();
+            $table->dateTime('publicerad')->nullable();
+            $table->string('titel')->nullable();
+            $table->string('subtitel')->nullable();
+            $table->string('status')->nullable();
+            $table->string('htmlformat')->nullable();
+            $table->string('relaterat_id')->nullable();
+            $table->string('source')->nullable();
+            $table->string('sourceid')->nullable();
+            $table->string('dokument_url_text')->nullable();
+            $table->string('dokument_url_html')->nullable();
+            $table->string('dokumentstatus_url_xml')->nullable();
+            $table->string('utskottsforslag_url_xml')->nullable();
+            $table->text('html')->nullable();
+        });
+        // dokutskottsforslag
+        Schema::create('dokutskottsforslag', function (Blueprint $table) {
+            $table->integer('hangar_id');
+            $table->integer('punkt');
+            $table->string('beteckning', 50)->nullable();
+            $table->string('rubrik')->nullable();
+            $table->string('forslag')->nullable();
+            $table->text('forslag_del2')->nullable();
+            $table->string('beslutstyp')->nullable();
+            $table->string('beslut', 100)->nullable();
+            $table->integer('motforslag_nummer')->nullable();
+            $table->string('motforslag_partier')->nullable();
+            $table->string('votering_id')->nullable();
+            $table->string('votering_sammanfattning_html')->nullable();
+            $table->string('votering_ledamot_url_xml')->nullable();
+            $table->string('rm')->nullable();
+            $table->string('bet')->nullable();
+            $table->string('vinnare')->nullable();
+        });
+        // dokmotforslag
+        Schema::create('dokmotforslag', function (Blueprint $table) {
+            $table->integer('hangar_id');
+            $table->integer('nummer');
+            $table->string('rubrik')->nullable();
+            $table->text('forslag')->nullable();
+            $table->string('partier')->nullable();
+            $table->string('typ')->nullable();
+            $table->integer('utskottsforslag_punkt')->nullable();
+            $table->string('id', 50)->nullable();
+        });
+        // dokaktivitet
+        Schema::create('dokaktivitet', function (Blueprint $table) {
+            $table->integer('hangar_id');
+            $table->string('kod')->nullable();
+            $table->string('namn')->nullable();
+            $table->dateTime('datum')->nullable();
+            $table->string('status')->nullable();
+            $table->string('ordning')->nullable();
+            $table->string('process')->nullable();
+        });
+        // dokintressent
+        Schema::create('dokintressent', function (Blueprint $table) {
+            $table->integer('hangar_id');
+            $table->string('intressent_id');
+            $table->string('namn')->nullable();
+            $table->string('partibet')->nullable();
+            $table->integer('ordning')->nullable();
+            $table->string('roll')->nullable();
+        });
+        // dokforslag
+        Schema::create('dokforslag', function (Blueprint $table) {
+            $table->integer('hangar_id');
+            $table->integer('nummer')->nullable();
+            $table->string('beteckning')->nullable();
+            $table->string('lydelse', 500)->nullable();
+            $table->string('lydelse2')->nullable();
+            $table->string('utskottet')->nullable();
+            $table->string('kammaren')->nullable();
+            $table->string('behandlas_i')->nullable();
+            $table->string('behandlas_i_punkt')->nullable();
+            $table->string('kammarbeslutstyp')->nullable();
+            $table->string('intressent')->nullable();
+            $table->string('avsnitt')->nullable();
+            $table->string('grundforfattning')->nullable();
+            $table->string('andringsforfattning')->nullable();
+        });
+        // dokuppgift
+        Schema::create('dokuppgift', function (Blueprint $table) {
+            $table->integer('hangar_id');
+            $table->string('kod')->nullable();
+            $table->string('namn')->nullable();
+            $table->text('text')->nullable();
+            $table->string('dok_id')->nullable();
+            $table->dateTime('systemdatum')->nullable();
+        });
+        // dokbilaga
+        Schema::create('dokbilaga', function (Blueprint $table) {
+            $table->integer('hangar_id');
+            $table->string('dok_id')->nullable();
+            $table->string('titel')->nullable();
+            $table->string('subtitel')->nullable();
+            $table->string('filnamn')->nullable();
+            $table->integer('filstorlek')->nullable();
+            $table->string('filtyp')->nullable();
+            $table->string('fil_url')->nullable();
+        });
+        // dokreferens
+        Schema::create('dokreferens', function (Blueprint $table) {
+            $table->integer('hangar_id');
+            $table->string('referenstyp')->nullable();
+            $table->string('uppgift')->nullable();
+            $table->string('ref_dok_id')->nullable();
+            $table->string('ref_dok_typ')->nullable();
+            $table->string('ref_dok_rm')->nullable();
+            $table->string('ref_dok_bet')->nullable();
+            $table->string('ref_dok_titel')->nullable();
+            $table->string('ref_dok_subtitel')->nullable();
+            $table->string('ref_dok_subtyp')->nullable();
+            $table->string('ref_dok_dokumentnamn')->nullable();
+        });
+        // debatt
+        Schema::create('debatt', function (Blueprint $table) {
+            $table->integer('hangar_id');
+            $table->string('video_id')->nullable();
+            $table->string('video_url')->nullable();
+            $table->integer('startpos')->nullable();
+            $table->string('tumnagel')->nullable();
+            $table->string('tumnagel_stor')->nullable();
+            $table->string('anf_video_id')->nullable();
+            $table->integer('anf_hangar_id')->nullable();
+            $table->integer('anf_sekunder')->nullable();
+            $table->string('anf_klockslag')->nullable();
+            $table->dateTime('datumtid')->nullable();
+            $table->dateTime('anf_datum')->nullable();
+            $table->string('anf_typ')->nullable();
+            $table->string('anf_text')->nullable();
+            $table->string('anf_beteckning')->nullable();
+            $table->string('anf_nummer')->nullable();
+            $table->string('talare')->nullable();
+            $table->string('intressent_id')->nullable();
+            $table->string('parti')->nullable();
+            $table->string('anf_rm')->nullable();
+        });
+        // votering
+        Schema::create('votering', function (Blueprint $table) {
+            $table->string('rm');
+            $table->string('beteckning')->nullable();
+            $table->integer('hangar_id');
+            $table->string('votering_id')->nullable();
+            $table->integer('punkt')->nullable();
+            $table->string('namn')->nullable();
+            $table->string('intressent_id')->nullable();
+            $table->string('parti')->nullable();
+            $table->string('valkrets')->nullable();
+            $table->integer('valkretsnummer')->nullable();
+            $table->string('iort')->nullable();
+            $table->string('rost')->nullable();
+            $table->string('avser')->nullable();
+            $table->string('votering')->nullable();
+            $table->integer('banknummer')->nullable();
+            $table->string('fornamn')->nullable();
+            $table->string('efternamn')->nullable();
+            $table->string('kon')->nullable();
+            $table->integer('fodd')->nullable();
+            $table->dateTime('datum')->nullable();
+        });
+        // anforande
+        Schema::create('anforande', function (Blueprint $table) {
+            $table->integer('dok_hangar_id');
+            $table->string('dok_id', 50);
+            $table->string('dok_titel')->nullable();
+            $table->string('dok_rm', 20)->nullable();
+            $table->integer('dok_nummer')->nullable();
+            $table->dateTime('dok_datum')->nullable();
+            $table->string('avsnittsrubrik')->nullable();
+            $table->string('underrubrik')->nullable();
+            $table->string('kammaraktivitet', 250)->nullable();
+            $table->string('anforande_id', 50);
+            $table->integer('anforande_nummer')->nullable();
+            $table->string('talare', 250)->nullable();
+            $table->string('parti', 50)->nullable();
+            $table->text('anforandetext')->nullable();
+            $table->string('intressent_id', 50)->nullable();
+            $table->string('rel_dok_id', 50)->nullable();
+            $table->char('replik', 1)->nullable();
+            $table->dateTime('systemdatum')->nullable();
+        });
+        // person
+        Schema::create('person', function (Blueprint $table) {
+            $table->string('intressent_id', 20)->primary();
+            $table->smallInteger('född_år')->nullable();
+            $table->string('kön', 6)->nullable();
+            $table->string('efternamn', 50)->nullable();
+            $table->string('tilltalsnamn', 50)->nullable();
+            $table->string('sorteringsnamn', 80)->nullable();
+            $table->string('iort', 40)->nullable();
+            $table->string('parti', 40)->nullable();
+            $table->string('valkrets', 50)->nullable();
+            $table->string('status', 100)->nullable();
+        });
+        // personuppdrag
+        Schema::create('personuppdrag', function (Blueprint $table) {
+            $table->string('organ_kod', 20);
+            $table->string('roll_kod', 40);
+            $table->integer('ordningsnummer');
+            $table->string('status', 20)->nullable();
+            $table->string('typ', 20)->nullable();
+            $table->dateTime('from')->nullable();
+            $table->dateTime('tom')->nullable();
+            $table->string('uppgift', 500)->nullable();
+            $table->string('intressent_id', 50);
+        });
+        // personuppgift
+        Schema::create('personuppgift', function (Blueprint $table) {
+            $table->string('uppgift_kod', 50);
+            $table->text('uppgift')->nullable();
+            $table->string('uppgift_typ', 50)->nullable();
+            $table->string('intressent_id', 50);
+        });
+        // planering
+        Schema::create('planering', function (Blueprint $table) {
+            $table->integer('nyckel');
+            $table->string('id', 50);
+            $table->string('rm', 12)->nullable();
+            $table->string('typ', 40)->nullable();
+            $table->char('dokserie_id', 2)->nullable();
+            $table->string('subtyp', 40)->nullable();
+            $table->string('bet', 40)->nullable();
+            $table->string('tempbet', 40)->nullable();
+            $table->string('intressent', 80)->nullable();
+            $table->integer('nummer')->nullable();
+            $table->integer('slutnummer')->nullable();
+            $table->dateTime('datum')->nullable();
+            $table->dateTime('publicerad')->nullable();
+            $table->string('status', 40)->nullable();
+            $table->string('titel', 300)->nullable();
+            $table->string('subtitel', 255)->nullable();
+            $table->text('html')->nullable();
+            $table->text('toc')->nullable();
+            $table->string('refcss', 66)->nullable();
+            $table->string('url', 100)->nullable();
+            $table->dateTime('uppdaterad')->nullable();
+            $table->integer('storlek')->nullable();
+            $table->string('source', 20)->nullable();
+            $table->dateTime('wn_expires')->nullable();
+            $table->string('wn_cachekey', 50)->nullable();
+            $table->string('wn_status', 20)->nullable();
+            $table->string('wn_checksum', 40)->nullable();
+            $table->integer('wn_nid')->nullable();
+            $table->string('wn_RawUrl', 255)->nullable();
+            $table->string('wn_SourceID', 80)->nullable();
+            $table->dateTime('timestamp')->nullable();
+            $table->string('rel_id', 50)->nullable();
+            $table->string('klockslag', 10)->nullable();
+            $table->string('grupp', 20)->nullable();
+            $table->string('format', 20)->nullable();
+            $table->string('intressent_id', 13)->nullable();
+            $table->string('mottagare_id', 13)->nullable();
+            $table->string('mottagare', 80)->nullable();
+            $table->integer('hangar_id')->nullable();
+            $table->string('plats', 150)->nullable();
+            $table->dateTime('slutdatum')->nullable();
+            $table->tinyInteger('webbtvlive')->nullable();
+        });
+        // organ
+        Schema::create('organ', function (Blueprint $table) {
+            $table->integer('id')->primary();
+            $table->string('kod', 50)->nullable();
+            $table->string('namn', 100)->nullable();
+            $table->string('typ', 50)->nullable();
+            $table->string('status', 12)->nullable();
+            $table->integer('sortering')->nullable();
+            $table->string('namn_en', 100)->nullable();
+            $table->string('domän', 50)->nullable();
+            $table->string('beskrivning', 1000)->nullable();
+        });
+        // roll
+        Schema::create('roll', function (Blueprint $table) {
+            $table->integer('pk')->primary();
+            $table->string('kod', 50)->nullable();
+            $table->string('namn', 100)->nullable();
+            $table->integer('sort')->nullable();
+        });
+        // riksmote
+        Schema::create('riksmote', function (Blueprint $table) {
+            $table->integer('pk')->primary();
+            $table->string('riksmote', 20)->nullable();
+            $table->string('id', 3)->nullable();
+            $table->dateTime('start')->nullable();
+            $table->dateTime('slut')->nullable();
+            $table->string('mandatperiod', 20)->nullable();
+        });
+    }
+
+    public function down()
+    {
+        Schema::dropIfExists('dokument');
+        Schema::dropIfExists('dokutskottsforslag');
+        Schema::dropIfExists('dokmotforslag');
+        Schema::dropIfExists('dokaktivitet');
+        Schema::dropIfExists('dokintressent');
+        Schema::dropIfExists('dokforslag');
+        Schema::dropIfExists('dokuppgift');
+        Schema::dropIfExists('dokbilaga');
+        Schema::dropIfExists('dokreferens');
+        Schema::dropIfExists('debatt');
+        Schema::dropIfExists('votering');
+        Schema::dropIfExists('anforande');
+        Schema::dropIfExists('person');
+        Schema::dropIfExists('personuppdrag');
+        Schema::dropIfExists('personuppgift');
+        Schema::dropIfExists('planering');
+        Schema::dropIfExists('organ');
+        Schema::dropIfExists('roll');
+        Schema::dropIfExists('riksmote');
+    }
+};

package-lock.json

@@ -13,6 +13,9 @@
                 "tailwindcss": "^4.0.7",
                 "vite": "^7.0.4"
             },
+            "devDependencies": {
+                "prettier-plugin-blade": "^2.1.21"
+            },
             "optionalDependencies": {
                 "@rollup/rollup-linux-x64-gnu": "4.9.5",
                 "@tailwindcss/oxide-linux-x64-gnu": "^4.0.1",
@@ -2056,6 +2059,36 @@
             "integrity": "sha512-1NNCs6uurfkVbeXG4S8JFT9t19m45ICnif8zWLd5oPSZ50QnwMfK+H3jv408d4jw/7Bttv5axS5IiHoLaVNHeQ==",
             "license": "MIT"
         },
+        "node_modules/prettier": {
+            "version": "3.7.4",
+            "resolved": "https://registry.npmjs.org/prettier/-/prettier-3.7.4.tgz",
+            "integrity": "sha512-v6UNi1+3hSlVvv8fSaoUbggEM5VErKmmpGA7Pl3HF8V6uKY7rvClBOJlH6yNwQtfTueNkGVpOv/mtWL9L4bgRA==",
+            "dev": true,
+            "license": "MIT",
+            "peer": true,
+            "bin": {
+                "prettier": "bin/prettier.cjs"
+            },
+            "engines": {
+                "node": ">=14"
+            },
+            "funding": {
+                "url": "https://github.com/prettier/prettier?sponsor=1"
+            }
+        },
+        "node_modules/prettier-plugin-blade": {
+            "version": "2.1.21",
+            "resolved": "https://registry.npmjs.org/prettier-plugin-blade/-/prettier-plugin-blade-2.1.21.tgz",
+            "integrity": "sha512-+BPBPvla/Ppr0MVrqMAO+FTwxpXUYo8zhQPIGC7psNuMbB24y84cGrJ4Uc02GHTQN0q8txeG4Y4MxyJWgOujyQ==",
+            "dev": true,
+            "license": "MIT",
+            "engines": {
+                "node": ">=12.0.0"
+            },
+            "peerDependencies": {
+                "prettier": ">=3"
+            }
+        },
         "node_modules/proxy-from-env": {
             "version": "1.1.0",
             "resolved": "https://registry.npmjs.org/proxy-from-env/-/proxy-from-env-1.1.0.tgz",

package.json

@@ -19,5 +19,8 @@
         "@rollup/rollup-linux-x64-gnu": "4.9.5",
         "@tailwindcss/oxide-linux-x64-gnu": "^4.0.1",
         "lightningcss-linux-x64-gnu": "^1.29.1"
+    },
+    "devDependencies": {
+        "prettier-plugin-blade": "^2.1.21"
     }
 }

resources/views/livewire/home-page.blade.php

@@ -6,30 +6,117 @@
                 Riksdagen App
             </h1>
             <p class="text-lg text-gray-600 max-w-2xl mx-auto">
-                Utforska information om riksdagsledamöter, deras röster och uppdrag i Sveriges riksdag
+                Utforska information om riksdagsledamöter, deras röster och
+                uppdrag i Sveriges riksdag
             </p>
         </div>
 
         <!-- Navigation Cards -->
-        <div class="grid grid-cols-1 md:grid-cols-2 lg:grid-cols-3 gap-6 max-w-6xl mx-auto">
+        <div
-
+            class="grid grid-cols-1 md:grid-cols-2 lg:grid-cols-3 gap-6 max-w-6xl mx-auto"
+        >
             <!-- Person Search Card -->
             <a wire:navigate href="{{ route('person.search') }}" class="group">
-                <div class="bg-white rounded-lg shadow-md hover:shadow-xl transition-all duration-300 transform hover:-translate-y-1 border border-gray-200 overflow-hidden">
+                <div
+                    class="bg-white rounded-lg shadow-md hover:shadow-xl transition-all duration-300 transform hover:-translate-y-1 border border-gray-200 overflow-hidden"
+                >
                     <div class="p-6">
-                        <div class="w-12 h-12 bg-blue-100 rounded-lg flex items-center justify-center mb-4 group-hover:bg-blue-200 transition-colors">
+                        <div
-                            <svg class="w-6 h-6 text-blue-600" fill="none" stroke="currentColor" viewBox="0 0 24 24">
+                            class="w-12 h-12 bg-blue-100 rounded-lg flex items-center justify-center mb-4 group-hover:bg-blue-200 transition-colors"
-                                <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2" d="M16 7a4 4 0 11-8 0 4 4 0 018 0zM12 14a7 7 0 00-7 7h14a7 7 0 00-7-7z"></path>
+                        >
+                            <svg
+                                class="w-6 h-6 text-blue-600"
+                                fill="none"
+                                stroke="currentColor"
+                                viewBox="0 0 24 24"
+                            >
+                                <path
+                                    stroke-linecap="round"
+                                    stroke-linejoin="round"
+                                    stroke-width="2"
+                                    d="M16 7a4 4 0 11-8 0 4 4 0 018 0zM12 14a7 7 0 00-7 7h14a7 7 0 00-7-7z"
+                                ></path>
                             </svg>
                         </div>
-                        <h3 class="text-xl font-semibold text-gray-900 mb-2">Ledamöter</h3>
+                        <h3 class="text-xl font-semibold text-gray-900 mb-2">
+                            Ledamöter
+                        </h3>
                         <p class="text-gray-600 mb-4">
-                            Sök och utforska information om riksdagsledamöter, deras rösthistorik och uppdrag
+                            Sök och utforska information om riksdagsledamöter,
+                            deras rösthistorik och uppdrag
                         </p>
-                        <div class="flex items-center text-blue-600 group-hover:text-blue-700">
+                        <div
-                            <span class="text-sm font-medium">Sök ledamöter</span>
+                            class="flex items-center text-blue-600 group-hover:text-blue-700"
-                            <svg class="w-4 h-4 ml-2 transform group-hover:translate-x-1 transition-transform" fill="none" stroke="currentColor" viewBox="0 0 24 24">
+                        >
-                                <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2" d="M9 5l7 7-7 7"></path>
+                            <span class="text-sm font-medium">
+                                Sök ledamöter
+                            </span>
+                            <svg
+                                class="w-4 h-4 ml-2 transform group-hover:translate-x-1 transition-transform"
+                                fill="none"
+                                stroke="currentColor"
+                                viewBox="0 0 24 24"
+                            >
+                                <path
+                                    stroke-linecap="round"
+                                    stroke-linejoin="round"
+                                    stroke-width="2"
+                                    d="M9 5l7 7-7 7"
+                                ></path>
+                            </svg>
+                        </div>
+                    </div>
+                </div>
+            </a>
+
+            <!-- Motion Search Card -->
+            <a wire:navigate href="{{ route('motion.search') }}" class="group">
+                <div
+                    class="bg-white rounded-lg h-full shadow-md hover:shadow-xl transition-all duration-300 transform hover:-translate-y-1 border border-gray-200 overflow-hidden"
+                >
+                    <div class="p-6">
+                        <div
+                            class="w-12 h-12 bg-green-100 rounded-lg flex items-center justify-center mb-4 group-hover:bg-green-200 transition-colors"
+                        >
+                            <svg
+                                class="w-6 h-6 text-green-600"
+                                fill="none"
+                                stroke="currentColor"
+                                viewBox="0 0 24 24"
+                            >
+                                <path
+                                    stroke-linecap="round"
+                                    stroke-linejoin="round"
+                                    stroke-width="2"
+                                    d="M9 12h6m-6 4h6m2 5H7a2 2 0 01-2-2V5a2 2 0 012-2h5.586a1 1 0 01.707.293l5.414 5.414a1 1 0 01.293.707V19a2 2 0 01-2 2z"
+                                ></path>
+                            </svg>
+                        </div>
+                        <h3 class="text-xl font-semibold text-gray-900 mb-2">
+                            Motioner
+                        </h3>
+                        <p class="text-gray-600 mb-4">
+                            Sök bland motioner som lämnats till riksdagen av
+                            ledamöterna
+                        </p>
+                        <div
+                            class="flex items-center text-green-600 group-hover:text-green-700"
+                        >
+                            <span class="text-sm font-medium">
+                                Sök motioner
+                            </span>
+                            <svg
+                                class="w-4 h-4 ml-2 transform group-hover:translate-x-1 transition-transform"
+                                fill="none"
+                                stroke="currentColor"
+                                viewBox="0 0 24 24"
+                            >
+                                <path
+                                    stroke-linecap="round"
+                                    stroke-linejoin="round"
+                                    stroke-width="2"
+                                    d="M9 5l7 7-7 7"
+                                ></path>
                             </svg>
                         </div>
                     </div>
@@ -37,16 +124,33 @@
             </a>
 
             <!-- Placeholder Card 1 -->
-            <div class="bg-white rounded-lg shadow-md border border-gray-200 overflow-hidden opacity-60">
+            <div
+                class="bg-white rounded-lg shadow-md border border-gray-200 overflow-hidden opacity-60"
+            >
                 <div class="p-6">
-                    <div class="w-12 h-12 bg-gray-100 rounded-lg flex items-center justify-center mb-4">
+                    <div
-                        <svg class="w-6 h-6 text-gray-400" fill="none" stroke="currentColor" viewBox="0 0 24 24">
+                        class="w-12 h-12 bg-gray-100 rounded-lg flex items-center justify-center mb-4"
-                            <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2" d="M9 5H7a2 2 0 00-2 2v10a2 2 0 002 2h8a2 2 0 002-2V7a2 2 0 00-2-2h-2M9 5a2 2 0 002 2h2a2 2 0 002-2M9 5a2 2 0 012-2h2a2 2 0 012 2"></path>
+                    >
+                        <svg
+                            class="w-6 h-6 text-gray-400"
+                            fill="none"
+                            stroke="currentColor"
+                            viewBox="0 0 24 24"
+                        >
+                            <path
+                                stroke-linecap="round"
+                                stroke-linejoin="round"
+                                stroke-width="2"
+                                d="M9 5H7a2 2 0 00-2 2v10a2 2 0 002 2h8a2 2 0 002-2V7a2 2 0 00-2-2h-2M9 5a2 2 0 002 2h2a2 2 0 002-2M9 5a2 2 0 012-2h2a2 2 0 012 2"
+                            ></path>
                         </svg>
                     </div>
-                    <h3 class="text-xl font-semibold text-gray-500 mb-2">Propositioner</h3>
+                    <h3 class="text-xl font-semibold text-gray-500 mb-2">
+                        Propositioner
+                    </h3>
                     <p class="text-gray-400 mb-4">
-                        Sök och läs propositioner och andra dokument från riksdagen
+                        Sök och läs propositioner och andra dokument från
+                        riksdagen
                     </p>
                     <div class="flex items-center text-gray-400">
                         <span class="text-sm font-medium">Kommer snart</span>
@@ -55,14 +159,30 @@
             </div>
 
             <!-- Placeholder Card 2 -->
-            <div class="bg-white rounded-lg shadow-md border border-gray-200 overflow-hidden opacity-60">
+            <div
+                class="bg-white rounded-lg shadow-md border border-gray-200 overflow-hidden opacity-60"
+            >
                 <div class="p-6">
-                    <div class="w-12 h-12 bg-gray-100 rounded-lg flex items-center justify-center mb-4">
+                    <div
-                        <svg class="w-6 h-6 text-gray-400" fill="none" stroke="currentColor" viewBox="0 0 24 24">
+                        class="w-12 h-12 bg-gray-100 rounded-lg flex items-center justify-center mb-4"
-                            <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2" d="M9 19v-6a2 2 0 00-2-2H5a2 2 0 00-2 2v6a2 2 0 002 2h2a2 2 0 002-2zm0 0V9a2 2 0 012-2h2a2 2 0 012 2v10m-6 0a2 2 0 002 2h2a2 2 0 002-2m0 0V5a2 2 0 012-2h2a2 2 0 012 2v14a2 2 0 01-2 2h-2a2 2 0 01-2-2z"></path>
+                    >
+                        <svg
+                            class="w-6 h-6 text-gray-400"
+                            fill="none"
+                            stroke="currentColor"
+                            viewBox="0 0 24 24"
+                        >
+                            <path
+                                stroke-linecap="round"
+                                stroke-linejoin="round"
+                                stroke-width="2"
+                                d="M9 19v-6a2 2 0 00-2-2H5a2 2 0 00-2 2v6a2 2 0 002 2h2a2 2 0 002-2zm0 0V9a2 2 0 012-2h2a2 2 0 012 2v10m-6 0a2 2 0 002 2h2a2 2 0 002-2m0 0V5a2 2 0 012-2h2a2 2 0 012 2v14a2 2 0 01-2 2h-2a2 2 0 01-2-2z"
+                            ></path>
                         </svg>
                     </div>
-                    <h3 class="text-xl font-semibold text-gray-500 mb-2">Statistik</h3>
+                    <h3 class="text-xl font-semibold text-gray-500 mb-2">
+                        Statistik
+                    </h3>
                     <p class="text-gray-400 mb-4">
                         Se röststatistik och analyser för partier och ledamöter
                     </p>
@@ -72,33 +192,31 @@
                 </div>
             </div>
 
-            <!-- Placeholder Card 3 -->
-            <div class="bg-white rounded-lg shadow-md border border-gray-200 overflow-hidden opacity-60">
-                <div class="p-6">
-                    <div class="w-12 h-12 bg-gray-100 rounded-lg flex items-center justify-center mb-4">
-                        <svg class="w-6 h-6 text-gray-400" fill="none" stroke="currentColor" viewBox="0 0 24 24">
-                            <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2" d="M8 7V3m8 4V3m-9 8h10M5 21h14a2 2 0 002-2V7a2 2 0 00-2-2H5a2 2 0 00-2 2v12a2 2 0 002 2z"></path>
-                        </svg>
-                    </div>
-                    <h3 class="text-xl font-semibold text-gray-500 mb-2">Kalender</h3>
-                    <p class="text-gray-400 mb-4">
-                        Se kommande voteringar och riksdagsmöten
-                    </p>
-                    <div class="flex items-center text-gray-400">
-                        <span class="text-sm font-medium">Kommer snart</span>
-                    </div>
-                </div>
-            </div>
-
             <!-- Placeholder Card 4 -->
-            <div class="bg-white rounded-lg shadow-md border border-gray-200 overflow-hidden opacity-60">
+            <div
+                class="bg-white rounded-lg shadow-md border border-gray-200 overflow-hidden opacity-60"
+            >
                 <div class="p-6">
-                    <div class="w-12 h-12 bg-gray-100 rounded-lg flex items-center justify-center mb-4">
+                    <div
-                        <svg class="w-6 h-6 text-gray-400" fill="none" stroke="currentColor" viewBox="0 0 24 24">
+                        class="w-12 h-12 bg-gray-100 rounded-lg flex items-center justify-center mb-4"
-                            <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2" d="M17 20h5v-2a3 3 0 00-5.356-1.857M17 20H7m10 0v-2c0-.656-.126-1.283-.356-1.857M7 20H2v-2a3 3 0 015.356-1.857M7 20v-2c0-.656.126-1.283.356-1.857m0 0a5.002 5.002 0 019.288 0M15 7a3 3 0 11-6 0 3 3 0 016 0zm6 3a2 2 0 11-4 0 2 2 0 014 0zM7 10a2 2 0 11-4 0 2 2 0 014 0z"></path>
+                    >
+                        <svg
+                            class="w-6 h-6 text-gray-400"
+                            fill="none"
+                            stroke="currentColor"
+                            viewBox="0 0 24 24"
+                        >
+                            <path
+                                stroke-linecap="round"
+                                stroke-linejoin="round"
+                                stroke-width="2"
+                                d="M17 20h5v-2a3 3 0 00-5.356-1.857M17 20H7m10 0v-2c0-.656-.126-1.283-.356-1.857M7 20H2v-2a3 3 0 015.356-1.857M7 20v-2c0-.656.126-1.283.356-1.857m0 0a5.002 5.002 0 019.288 0M15 7a3 3 0 11-6 0 3 3 0 016 0zm6 3a2 2 0 11-4 0 2 2 0 014 0zM7 10a2 2 0 11-4 0 2 2 0 014 0z"
+                            ></path>
                         </svg>
                     </div>
-                    <h3 class="text-xl font-semibold text-gray-500 mb-2">Partier</h3>
+                    <h3 class="text-xl font-semibold text-gray-500 mb-2">
+                        Partier
+                    </h3>
                     <p class="text-gray-400 mb-4">
                         Utforska partier och deras ståndpunkter i olika frågor
                     </p>
@@ -109,14 +227,30 @@
             </div>
 
             <!-- Placeholder Card 5 -->
-            <div class="bg-white rounded-lg shadow-md border border-gray-200 overflow-hidden opacity-60">
+            <div
+                class="bg-white rounded-lg shadow-md border border-gray-200 overflow-hidden opacity-60"
+            >
                 <div class="p-6">
-                    <div class="w-12 h-12 bg-gray-100 rounded-lg flex items-center justify-center mb-4">
+                    <div
-                        <svg class="w-6 h-6 text-gray-400" fill="none" stroke="currentColor" viewBox="0 0 24 24">
+                        class="w-12 h-12 bg-gray-100 rounded-lg flex items-center justify-center mb-4"
-                            <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2" d="M21 21l-6-6m2-5a7 7 0 11-14 0 7 7 0 0114 0z"></path>
+                    >
+                        <svg
+                            class="w-6 h-6 text-gray-400"
+                            fill="none"
+                            stroke="currentColor"
+                            viewBox="0 0 24 24"
+                        >
+                            <path
+                                stroke-linecap="round"
+                                stroke-linejoin="round"
+                                stroke-width="2"
+                                d="M21 21l-6-6m2-5a7 7 0 11-14 0 7 7 0 0114 0z"
+                            ></path>
                         </svg>
                     </div>
-                    <h3 class="text-xl font-semibold text-gray-500 mb-2">Sök Allmänt</h3>
+                    <h3 class="text-xl font-semibold text-gray-500 mb-2">
+                        Sök Allmänt
+                    </h3>
                     <p class="text-gray-400 mb-4">
                         Sök i alla riksdagens dokument och voteringar
                     </p>
@@ -125,7 +259,6 @@
                     </div>
                 </div>
             </div>
-
         </div>
     </div>
 </div>

resources/views/livewire/motion/search.blade.php

@@ -0,0 +1,361 @@
+<div class="min-h-screen bg-gradient-to-br from-blue-50 to-indigo-100">
+    <div class="container mx-auto py-12 px-4">
+        <!-- Breadcrumb Navigation -->
+        <nav class="mb-8" aria-label="Breadcrumb">
+            <div
+                class="bg-white rounded-lg shadow-sm border border-gray-200 px-4 py-3"
+            >
+                <ol class="flex items-center space-x-2 text-sm text-gray-600">
+                    <li>
+                        <a
+                            wire:navigate
+                            href="{{ route('home') }}"
+                            class="text-blue-600 hover:text-blue-700 flex items-center"
+                        >
+                            <svg
+                                class="w-4 h-4 mr-1"
+                                fill="none"
+                                stroke="currentColor"
+                                viewBox="0 0 24 24"
+                            >
+                                <path
+                                    stroke-linecap="round"
+                                    stroke-linejoin="round"
+                                    stroke-width="2"
+                                    d="M3 12l2-2m0 0l7-7 7 7M5 10v10a1 1 0 001 1h3m10-11l2 2m-2-2v10a1 1 0 01-1 1h-3m-6 0a1 1 0 001-1v-4a1 1 0 011-1h2a1 1 0 011 1v4a1 1 0 001 1m-6 0h6"
+                                ></path>
+                            </svg>
+                            Hem
+                        </a>
+                    </li>
+                    <li>
+                        <svg
+                            class="w-4 h-4 text-gray-400"
+                            fill="currentColor"
+                            viewBox="0 0 20 20"
+                        >
+                            <path
+                                fill-rule="evenodd"
+                                d="M7.293 14.707a1 1 0 010-1.414L10.586 10 7.293 6.707a1 1 0 011.414-1.414l4 4a1 1 0 010 1.414l-4 4a1 1 0 01-1.414 0z"
+                                clip-rule="evenodd"
+                            ></path>
+                        </svg>
+                    </li>
+                    <li class="font-medium text-gray-900">Sök Motioner</li>
+                </ol>
+            </div>
+        </nav>
+
+        <!-- Header -->
+        <div class="text-center mb-8">
+            <h1 class="text-4xl font-bold text-gray-900 mb-4">Sök Motioner</h1>
+            <p class="text-lg text-gray-600">
+                Sök bland alla motioner som lämnats till riksdagen
+            </p>
+        </div>
+
+        <!-- Search Form -->
+        <div
+            class="bg-white rounded-lg shadow-md border border-gray-200 p-6 mb-8"
+        >
+            <div class="grid grid-cols-1 md:grid-cols-3 gap-4">
+                <!-- Query Search -->
+                <div>
+                    <label
+                        for="query"
+                        class="block text-sm font-medium text-gray-700 mb-2"
+                    >
+                        Sökfras
+                    </label>
+                    <input
+                        type="text"
+                        id="query"
+                        wire:model.live.debounce.500ms="query"
+                        class="w-full px-3 py-2 border border-gray-300 rounded-md shadow-sm focus:outline-none focus:ring-blue-500 focus:border-blue-500 text-black"
+                        placeholder="Sök efter nyckelord..."
+                    />
+                </div>
+
+                <!-- Party Select -->
+                <div>
+                    <label
+                        for="party"
+                        class="block text-sm font-medium text-gray-700 mb-2"
+                    >
+                        Parti
+                    </label>
+                    <select
+                        id="party"
+                        wire:model.live="party"
+                        class="w-full px-3 py-2 border border-gray-300 rounded-md shadow-sm focus:outline-none focus:ring-blue-500 focus:border-blue-500 text-black"
+                    >
+                        <option value="">Alla partier</option>
+                        @foreach ($this->parties as $code => $name)
+                            <option value="{{ $code }}">{{ $name }}</option>
+                        @endforeach
+                    </select>
+                </div>
+
+                <!-- Date Interval -->
+                <div>
+                    <label
+                        for="dateInterval"
+                        class="block text-sm font-medium text-gray-700 mb-2"
+                    >
+                        Riksdagsår
+                    </label>
+                    <select
+                        id="dateInterval"
+                        wire:model.live="dateInterval"
+                        class="w-full px-3 py-2 border border-gray-300 rounded-md shadow-sm focus:outline-none focus:ring-blue-500 focus:border-blue-500 text-black"
+                    >
+                        <option value="">Alla år</option>
+                        @foreach ($this->dateIntervals as $interval => $label)
+                            <option value="{{ $interval }}">
+                                {{ $label }}
+                            </option>
+                        @endforeach
+                    </select>
+                </div>
+            </div>
+
+            <!-- Clear Filters Button -->
+            <div class="mt-4 flex justify-end">
+                <button
+                    wire:click="clearFilters"
+                    class="px-4 py-2 text-sm font-medium text-gray-700 bg-gray-100 border border-gray-300 rounded-md hover:bg-gray-200 focus:outline-none focus:ring-2 focus:ring-offset-2 focus:ring-gray-500"
+                >
+                    Rensa filter
+                </button>
+            </div>
+        </div>
+
+        <!-- Loading State -->
+        <div class="hidden" wire:loading.block>
+            <div class="flex justify-center items-center py-16">
+                <div
+                    class="w-12 h-12 border-4 border-t-blue-600 border-blue-200 rounded-full animate-spin"
+                ></div>
+                <span class="ml-4 text-gray-600 font-medium">
+                    Söker motioner...
+                </span>
+            </div>
+        </div>
+
+        <!-- Results -->
+        @if (! $loading)
+            @if ($this->motions->isNotEmpty())
+                <!-- Results Header -->
+                <div
+                    class="bg-white rounded-lg shadow-md border border-gray-200 p-4 mb-6"
+                >
+                    <div class="flex justify-between items-center">
+                        <h2 class="text-lg font-medium text-gray-900">
+                            Hittade {{ number_format($this->totalResults) }}
+                            motioner
+                        </h2>
+                        <div class="text-sm text-gray-500">
+                            Sida {{ $this->getPage() }} av
+                            {{ $paginatedMotions->lastPage() }}
+                        </div>
+                    </div>
+                </div>
+
+                <!-- Motion Cards -->
+                <div class="space-y-4 mb-8">
+                    @foreach ($paginatedMotions as $motion)
+                        <div
+                            class="bg-white rounded-lg shadow-md border border-gray-200 p-6 hover:shadow-lg transition-shadow"
+                        >
+                            <div
+                                class="flex flex-col lg:flex-row lg:items-start gap-4"
+                            >
+                                <div class="flex-1">
+                                    <div
+                                        class="flex items-start justify-between mb-3"
+                                    >
+                                        <div>
+                                            <h3
+                                                class="text-lg font-semibold text-gray-900 mb-1"
+                                            >
+                                                <a
+                                                    wire:navigate
+                                                    href="{{ route('motion.show', $motion->dok_id) }}"
+                                                    class="hover:text-blue-600 transition-colors"
+                                                >
+                                                    {{ $motion->titel }}
+                                                </a>
+                                            </h3>
+                                            @if (! empty($motion->undertitel))
+                                                <p
+                                                    class="text-sm text-gray-600 mb-2"
+                                                >
+                                                    {{ $motion->undertitel }}
+                                                </p>
+                                            @endif
+                                        </div>
+                                        <span
+                                            class="inline-flex px-3 py-1 text-xs font-semibold rounded-full {{ $motion->subtyp == 'Partimotion' ? 'bg-blue-100 text-blue-800' : 'bg-green-100 text-green-800' }}"
+                                        >
+                                            {{ $motion->subtyp }}
+                                        </span>
+                                    </div>
+
+                                    <div
+                                        class="grid grid-cols-2 lg:grid-cols-4 gap-4 mb-4"
+                                    >
+                                        <div>
+                                            <span
+                                                class="text-xs font-medium text-gray-500 uppercase"
+                                            >
+                                                Beteckning
+                                            </span>
+                                            <p
+                                                class="text-sm font-medium text-gray-900"
+                                            >
+                                                {{ $motion->rm }}:{{ $motion->beteckning }}
+                                            </p>
+                                        </div>
+                                        <div>
+                                            <span
+                                                class="text-xs font-medium text-gray-500 uppercase"
+                                            >
+                                                Datum
+                                            </span>
+                                            <p class="text-sm text-gray-900">
+                                                {{ \Carbon\Carbon::parse($motion->datum)->format('Y-m-d') }}
+                                            </p>
+                                        </div>
+                                        <div>
+                                            <span
+                                                class="text-xs font-medium text-gray-500 uppercase"
+                                            >
+                                                Status
+                                            </span>
+                                            <span
+                                                class="inline-flex px-2 py-1 text-xs font-semibold rounded-full {{
+                                                    $motion->status == 'Hänvisad'
+                                                        ? 'bg-yellow-100 text-yellow-800'
+                                                        : ($motion->status == 'Avslutad'
+                                                            ? 'bg-green-100 text-green-800'
+                                                            : 'bg-gray-100 text-gray-800')
+                                                }}"
+                                            >
+                                                {{ $motion->status }}
+                                            </span>
+                                        </div>
+                                        <div>
+                                            <span
+                                                class="text-xs font-medium text-gray-500 uppercase"
+                                            >
+                                                Utskott
+                                            </span>
+                                            <p class="text-sm text-gray-900">
+                                                {{ $motion->organ ?: '-' }}
+                                            </p>
+                                        </div>
+                                    </div>
+
+                                    @if (! empty($motion->summary))
+                                        <p
+                                            class="text-sm text-gray-700 line-clamp-3 mb-4"
+                                        >
+                                            {!! strip_tags($motion->summary, '<mark>') !!}
+                                        </p>
+                                    @endif
+                                </div>
+
+                                <!-- Actions -->
+                                <div
+                                    class="flex-shrink-0 flex flex-row lg:flex-col gap-2"
+                                >
+                                    <a
+                                        wire:navigate
+                                        href="{{ route('motion.show', $motion->dok_id) }}"
+                                        class="px-4 py-2 text-sm font-medium text-white bg-blue-600 rounded-md hover:bg-blue-700 focus:outline-none focus:ring-2 focus:ring-offset-2 focus:ring-blue-500 text-center"
+                                    >
+                                        Visa detaljer
+                                    </a>
+                                    @if (! empty($motion->dokument_url_html))
+                                        <a
+                                            href="https:{{ $motion->dokument_url_html }}"
+                                            target="_blank"
+                                            class="px-4 py-2 text-sm font-medium text-gray-700 bg-gray-100 rounded-md hover:bg-gray-200 focus:outline-none focus:ring-2 focus:ring-offset-2 focus:ring-gray-500 text-center"
+                                        >
+                                            Läs motion
+                                        </a>
+                                    @endif
+                                </div>
+                            </div>
+                        </div>
+                    @endforeach
+                </div>
+
+                <!-- Pagination -->
+                <div
+                    class="bg-white rounded-lg shadow-md border border-gray-200 p-4"
+                >
+                    @if ($paginatedMotions)
+                        {{ $paginatedMotions->links() }}
+                    @endif
+                </div>
+            @elseif (! empty($query) || ! empty($party) || ! empty($dateInterval))
+                <!-- No Results -->
+                <div
+                    class="bg-white rounded-lg shadow-md border border-gray-200 p-8 text-center"
+                >
+                    <svg
+                        class="w-16 h-16 text-gray-400 mx-auto mb-4"
+                        fill="none"
+                        stroke="currentColor"
+                        viewBox="0 0 24 24"
+                    >
+                        <path
+                            stroke-linecap="round"
+                            stroke-linejoin="round"
+                            stroke-width="2"
+                            d="M9 12h6m-6 4h6m2 5H7a2 2 0 01-2-2V5a2 2 0 012-2h5.586a1 1 0 01.707.293l5.414 5.414a1 1 0 01.293.707V19a2 2 0 01-2 2z"
+                        ></path>
+                    </svg>
+                    <h3 class="text-lg font-medium text-gray-900 mb-2">
+                        Inga motioner hittades
+                    </h3>
+                    <p class="text-gray-600 mb-4">
+                        Försök ändra dina sökkriterier.
+                    </p>
+                    <button
+                        wire:click="clearFilters"
+                        class="px-4 py-2 text-sm font-medium text-white bg-blue-600 rounded-md hover:bg-blue-700 focus:outline-none focus:ring-2 focus:ring-offset-2 focus:ring-blue-500"
+                    >
+                        Rensa filter
+                    </button>
+                </div>
+            @else
+                <!-- Initial State -->
+                <div
+                    class="bg-white rounded-lg shadow-md border border-gray-200 p-8 text-center"
+                >
+                    <svg
+                        class="w-16 h-16 text-gray-400 mx-auto mb-4"
+                        fill="none"
+                        stroke="currentColor"
+                        viewBox="0 0 24 24"
+                    >
+                        <path
+                            stroke-linecap="round"
+                            stroke-linejoin="round"
+                            stroke-width="2"
+                            d="M21 21l-6-6m2-5a7 7 0 11-14 0 7 7 0 0114 0z"
+                        ></path>
+                    </svg>
+                    <h3 class="text-lg font-medium text-gray-900 mb-2">
+                        Börja din sökning
+                    </h3>
+                    <p class="text-gray-600">
+                        Använd sökfälten ovan för att hitta motioner.
+                    </p>
+                </div>
+            @endif
+        @endif
+    </div>
+</div>

resources/views/livewire/motion/show.blade.php

@@ -0,0 +1,486 @@
+<div class="min-h-screen bg-gradient-to-br from-blue-50 to-indigo-100">
+    <div class="container mx-auto py-12 px-4">
+        <!-- Breadcrumb Navigation -->
+        <nav class="mb-8" aria-label="Breadcrumb">
+            <div
+                class="bg-white rounded-lg shadow-sm border border-gray-200 px-4 py-3"
+            >
+                <ol class="flex items-center space-x-2 text-sm text-gray-600">
+                    <li>
+                        <a
+                            wire:navigate
+                            href="{{ route('home') }}"
+                            class="text-blue-600 hover:text-blue-700 flex items-center"
+                        >
+                            <svg
+                                class="w-4 h-4 mr-1"
+                                fill="none"
+                                stroke="currentColor"
+                                viewBox="0 0 24 24"
+                            >
+                                <path
+                                    stroke-linecap="round"
+                                    stroke-linejoin="round"
+                                    stroke-width="2"
+                                    d="M3 12l2-2m0 0l7-7 7 7M5 10v10a1 1 0 001 1h3m10-11l2 2m-2-2v10a1 1 0 01-1 1h-3m-6 0a1 1 0 001-1v-4a1 1 0 011-1h2a1 1 0 011 1v4a1 1 0 001 1m-6 0h6"
+                                ></path>
+                            </svg>
+                            Hem
+                        </a>
+                    </li>
+                    <li>
+                        <svg
+                            class="w-4 h-4 text-gray-400"
+                            fill="currentColor"
+                            viewBox="0 0 20 20"
+                        >
+                            <path
+                                fill-rule="evenodd"
+                                d="M7.293 14.707a1 1 0 010-1.414L10.586 10 7.293 6.707a1 1 0 011.414-1.414l4 4a1 1 0 010 1.414l-4 4a1 1 0 01-1.414 0z"
+                                clip-rule="evenodd"
+                            ></path>
+                        </svg>
+                    </li>
+                    <li>
+                        <a
+                            wire:navigate
+                            href="{{ route('motion.search') }}"
+                            class="text-blue-600 hover:text-blue-700"
+                        >
+                            Sök Motioner
+                        </a>
+                    </li>
+                    <li>
+                        <svg
+                            class="w-4 h-4 text-gray-400"
+                            fill="currentColor"
+                            viewBox="0 0 20 20"
+                        >
+                            <path
+                                fill-rule="evenodd"
+                                d="M7.293 14.707a1 1 0 010-1.414L10.586 10 7.293 6.707a1 1 0 011.414-1.414l4 4a1 1 0 010 1.414l-4 4a1 1 0 01-1.414 0z"
+                                clip-rule="evenodd"
+                            ></path>
+                        </svg>
+                    </li>
+                    <li class="font-medium text-gray-900">
+                        Motion
+                        {{ $motion->rm ?? '' }}:{{ $motion->beteckning ?? $motionId }}
+                    </li>
+                </ol>
+            </div>
+        </nav>
+
+        @if ($motion)
+            <!-- Motion Header -->
+            <div
+                class="bg-white rounded-lg shadow-md border border-gray-200 p-8 mb-8"
+            >
+                <div class="flex flex-col lg:flex-row lg:items-start gap-6">
+                    <div class="flex-1">
+                        <div class="flex items-start justify-between mb-4">
+                            <div>
+                                <h1
+                                    class="text-3xl font-bold text-gray-900 mb-2"
+                                >
+                                    {{ $motion->titel }}
+                                </h1>
+                                @if (! empty($motion->undertitel))
+                                    <p class="text-lg text-gray-600 mb-4">
+                                        {{ $motion->undertitel }}
+                                    </p>
+                                @endif
+                            </div>
+                            <span
+                                class="inline-flex px-3 py-1 text-sm font-semibold rounded-full {{ $motion->subtyp == 'Partimotion' ? 'bg-blue-100 text-blue-800' : 'bg-green-100 text-green-800' }}"
+                            >
+                                {{ $motion->subtyp }}
+                            </span>
+                        </div>
+
+                        <!-- Motion Details Grid -->
+                        <div
+                            class="grid grid-cols-1 md:grid-cols-2 lg:grid-cols-4 gap-4 mb-6"
+                        >
+                            <div class="bg-gray-50 rounded-lg p-4">
+                                <div
+                                    class="text-sm font-medium text-gray-500 mb-1"
+                                >
+                                    Beteckning
+                                </div>
+                                <div class="text-gray-900 font-semibold">
+                                    {{ $motion->rm }}:{{ $motion->beteckning }}
+                                </div>
+                            </div>
+                            <div class="bg-gray-50 rounded-lg p-4">
+                                <div
+                                    class="text-sm font-medium text-gray-500 mb-1"
+                                >
+                                    Datum
+                                </div>
+                                <div class="text-gray-900">
+                                    {{ \Carbon\Carbon::parse($motion->datum)->format('Y-m-d') }}
+                                </div>
+                            </div>
+                            <div class="bg-gray-50 rounded-lg p-4">
+                                <div
+                                    class="text-sm font-medium text-gray-500 mb-1"
+                                >
+                                    Status
+                                </div>
+                                <span
+                                    class="inline-flex px-2 py-1 text-xs font-semibold rounded-full {{
+                                        $motion->status == 'Hänvisad'
+                                            ? 'bg-yellow-100 text-yellow-800'
+                                            : ($motion->status == 'Avslutad'
+                                                ? 'bg-green-100 text-green-800'
+                                                : 'bg-gray-100 text-gray-800')
+                                    }}"
+                                >
+                                    {{ $motion->status }}
+                                </span>
+                            </div>
+                            <div class="bg-gray-50 rounded-lg p-4">
+                                <div
+                                    class="text-sm font-medium text-gray-500 mb-1"
+                                >
+                                    Utskott
+                                </div>
+                                <div class="text-gray-900">
+                                    {{ $motion->organ ?: 'Ej tilldelat' }}
+                                </div>
+                            </div>
+                        </div>
+
+                        <!-- Action Buttons -->
+                        <div class="flex flex-wrap gap-3">
+                            @if (! empty($motion->dokument_url_html))
+                                <a
+                                    href="https:{{ $motion->dokument_url_html }}"
+                                    target="_blank"
+                                    class="px-4 py-2 text-sm font-medium text-white bg-blue-600 rounded-md hover:bg-blue-700 focus:outline-none focus:ring-2 focus:ring-offset-2 focus:ring-blue-500"
+                                >
+                                    <svg
+                                        class="w-4 h-4 inline mr-1"
+                                        fill="none"
+                                        stroke="currentColor"
+                                        viewBox="0 0 24 24"
+                                    >
+                                        <path
+                                            stroke-linecap="round"
+                                            stroke-linejoin="round"
+                                            stroke-width="2"
+                                            d="M10 6H6a2 2 0 00-2 2v10a2 2 0 002 2h10a2 2 0 002-2v-4M14 4h6m0 0v6m0-6L10 14"
+                                        ></path>
+                                    </svg>
+                                    Läs fullständig motion
+                                </a>
+                            @endif
+
+                            <a
+                                href="{{ $this->riksdagenUrl }}"
+                                target="_blank"
+                                class="px-4 py-2 text-sm font-medium text-gray-700 bg-gray-100 rounded-md hover:bg-gray-200 focus:outline-none focus:ring-2 focus:ring-offset-2 focus:ring-gray-500"
+                            >
+                                <svg
+                                    class="w-4 h-4 inline mr-1"
+                                    fill="none"
+                                    stroke="currentColor"
+                                    viewBox="0 0 24 24"
+                                >
+                                    <path
+                                        stroke-linecap="round"
+                                        stroke-linejoin="round"
+                                        stroke-width="2"
+                                        d="M10 6H6a2 2 0 00-2 2v10a2 2 0 002 2h10a2 2 0 002-2v-4M14 4h6m0 0v6m0-6L10 14"
+                                    ></path>
+                                </svg>
+                                Visa på riksdag.se
+                            </a>
+                        </div>
+                    </div>
+                </div>
+            </div>
+
+            <!-- Motion Summary -->
+            @if (! empty($motion->summary))
+                <div
+                    class="bg-white rounded-lg shadow-md border border-gray-200 p-6 mb-8"
+                >
+                    <div class="flex items-center mb-4">
+                        <div
+                            class="w-10 h-10 bg-blue-100 rounded-lg flex items-center justify-center mr-3"
+                        >
+                            <svg
+                                class="w-5 h-5 text-blue-600"
+                                fill="none"
+                                stroke="currentColor"
+                                viewBox="0 0 24 24"
+                            >
+                                <path
+                                    stroke-linecap="round"
+                                    stroke-linejoin="round"
+                                    stroke-width="2"
+                                    d="M9 12h6m-6 4h6m2 5H7a2 2 0 01-2-2V5a2 2 0 012-2h5.586a1 1 0 01.707.293l5.414 5.414a1 1 0 01.293.707V19a2 2 0 01-2 2z"
+                                ></path>
+                            </svg>
+                        </div>
+                        <h2 class="text-xl font-bold text-gray-900">
+                            Sammanfattning
+                        </h2>
+                    </div>
+                    <div
+                        class="prose max-w-none text-gray-700 whitespace-pre-line"
+                    >
+                        {!! strip_tags($motion->summary, '<mark>') !!}
+                    </div>
+                </div>
+            @endif
+
+            <!-- Authors Section -->
+            @if ($this->authors->isNotEmpty())
+                <div
+                    class="bg-white rounded-lg shadow-md border border-gray-200 p-6 mb-8"
+                >
+                    <div class="flex items-center mb-4">
+                        <div
+                            class="w-10 h-10 bg-green-100 rounded-lg flex items-center justify-center mr-3"
+                        >
+                            <svg
+                                class="w-5 h-5 text-green-600"
+                                fill="none"
+                                stroke="currentColor"
+                                viewBox="0 0 24 24"
+                            >
+                                <path
+                                    stroke-linecap="round"
+                                    stroke-linejoin="round"
+                                    stroke-width="2"
+                                    d="M12 4.354a4 4 0 110 5.292M15 21H3v-1a6 6 0 0112 0v1zm0 0h6v-1a6 6 0 00-9-5.197m13.5-9a2.5 2.5 0 11-5 0 2.5 2.5 0 015 0z"
+                                ></path>
+                            </svg>
+                        </div>
+                        <h2 class="text-xl font-bold text-gray-900">
+                            Motionärer ({{ $this->authors->count() }})
+                        </h2>
+                    </div>
+                    <div
+                        class="grid grid-cols-1 md:grid-cols-2 lg:grid-cols-3 gap-4"
+                    >
+                        @foreach ($this->authors as $author)
+                            <div class="bg-gray-50 rounded-lg p-4">
+                                <div class="flex items-center justify-between">
+                                    <div>
+                                        <div
+                                            class="font-semibold text-gray-900"
+                                        >
+                                            {{ $author->namn }}
+                                        </div>
+                                        <div class="text-sm text-gray-600">
+                                            {{ $author->partibet }}
+                                        </div>
+                                    </div>
+                                    <a
+                                        wire:navigate
+                                        href="{{ route('person.show', $author->intressent_id) }}"
+                                        class="text-blue-600 hover:text-blue-700 text-sm font-medium"
+                                    >
+                                        Visa profil
+                                    </a>
+                                </div>
+                            </div>
+                        @endforeach
+                    </div>
+                </div>
+            @endif
+
+            <!-- File Attachments -->
+            @if ($this->attachments->isNotEmpty())
+                <div
+                    class="bg-white rounded-lg shadow-md border border-gray-200 p-6 mb-8"
+                >
+                    <div class="flex items-center mb-4">
+                        <div
+                            class="w-10 h-10 bg-purple-100 rounded-lg flex items-center justify-center mr-3"
+                        >
+                            <svg
+                                class="w-5 h-5 text-purple-600"
+                                fill="none"
+                                stroke="currentColor"
+                                viewBox="0 0 24 24"
+                            >
+                                <path
+                                    stroke-linecap="round"
+                                    stroke-linejoin="round"
+                                    stroke-width="2"
+                                    d="M15.172 7l-6.586 6.586a2 2 0 102.828 2.828l6.414-6.586a4 4 0 00-5.656-5.656l-6.415 6.585a6 6 0 108.486 8.486L20.5 13"
+                                ></path>
+                            </svg>
+                        </div>
+                        <h2 class="text-xl font-bold text-gray-900">Bilagor</h2>
+                    </div>
+                    <div class="space-y-3">
+                        @foreach ($this->attachments as $file)
+                            <div
+                                class="flex items-center justify-between p-4 bg-gray-50 rounded-lg"
+                            >
+                                <div class="flex items-center">
+                                    <div class="flex-shrink-0">
+                                        @if ($file->typ == 'pdf')
+                                            <svg
+                                                class="w-8 h-8 text-red-600"
+                                                fill="currentColor"
+                                                viewBox="0 0 20 20"
+                                            >
+                                                <path
+                                                    fill-rule="evenodd"
+                                                    d="M4 4a2 2 0 012-2h4.586A2 2 0 0112 2.586L15.414 6A2 2 0 0116 7.414V16a2 2 0 01-2 2H6a2 2 0 01-2-2V4zm2 6a1 1 0 011-1h6a1 1 0 110 2H7a1 1 0 01-1-1zm1 3a1 1 0 100 2h6a1 1 0 100-2H7z"
+                                                    clip-rule="evenodd"
+                                                ></path>
+                                            </svg>
+                                        @elseif ($file->typ == 'docx')
+                                            <svg
+                                                class="w-8 h-8 text-blue-600"
+                                                fill="currentColor"
+                                                viewBox="0 0 20 20"
+                                            >
+                                                <path
+                                                    fill-rule="evenodd"
+                                                    d="M4 4a2 2 0 012-2h4.586A2 2 0 0112 2.586L15.414 6A2 2 0 0116 7.414V16a2 2 0 01-2 2H6a2 2 0 01-2-2V4zm2 6a1 1 0 011-1h6a1 1 0 110 2H7a1 1 0 01-1-1zm1 3a1 1 0 100 2h6a1 1 0 100-2H7z"
+                                                    clip-rule="evenodd"
+                                                ></path>
+                                            </svg>
+                                        @else
+                                            <svg
+                                                class="w-8 h-8 text-gray-600"
+                                                fill="currentColor"
+                                                viewBox="0 0 20 20"
+                                            >
+                                                <path
+                                                    fill-rule="evenodd"
+                                                    d="M4 4a2 2 0 012-2h4.586A2 2 0 0112 2.586L15.414 6A2 2 0 0116 7.414V16a2 2 0 01-2 2H6a2 2 0 01-2-2V4zm2 6a1 1 0 011-1h6a1 1 0 110 2H7a1 1 0 01-1-1zm1 3a1 1 0 100 2h6a1 1 0 100-2H7z"
+                                                    clip-rule="evenodd"
+                                                ></path>
+                                            </svg>
+                                        @endif
+                                    </div>
+                                    <div class="ml-4">
+                                        <div
+                                            class="text-sm font-medium text-gray-900"
+                                        >
+                                            {{ $file->namn }}
+                                        </div>
+                                        <div class="text-sm text-gray-500">
+                                            {{ strtoupper($file->typ) }} •
+                                            {{ number_format($file->storlek / 1024, 1) }}
+                                            KB
+                                        </div>
+                                    </div>
+                                </div>
+                                <a
+                                    href="{{ $file->url }}"
+                                    target="_blank"
+                                    class="px-3 py-1 text-sm font-medium text-blue-600 bg-blue-50 rounded-md hover:bg-blue-100 focus:outline-none focus:ring-2 focus:ring-offset-2 focus:ring-blue-500"
+                                >
+                                    Ladda ner
+                                </a>
+                            </div>
+                        @endforeach
+                    </div>
+                </div>
+            @endif
+
+            <!-- Additional Information -->
+            <div
+                class="bg-white rounded-lg shadow-md border border-gray-200 p-6"
+            >
+                <div class="flex items-center mb-4">
+                    <div
+                        class="w-10 h-10 bg-gray-100 rounded-lg flex items-center justify-center mr-3"
+                    >
+                        <svg
+                            class="w-5 h-5 text-gray-600"
+                            fill="none"
+                            stroke="currentColor"
+                            viewBox="0 0 24 24"
+                        >
+                            <path
+                                stroke-linecap="round"
+                                stroke-linejoin="round"
+                                stroke-width="2"
+                                d="M13 16h-1v-4h-1m1-4h.01M21 12a9 9 0 11-18 0 9 9 0 0118 0z"
+                            ></path>
+                        </svg>
+                    </div>
+                    <h2 class="text-xl font-bold text-gray-900">
+                        Teknisk information
+                    </h2>
+                </div>
+                <div class="grid grid-cols-1 md:grid-cols-2 gap-4">
+                    <div class="bg-gray-50 rounded-lg p-4">
+                        <div class="text-sm font-medium text-gray-500 mb-1">
+                            Dokument-ID
+                        </div>
+                        <div class="text-gray-900 font-mono">
+                            {{ $motion->dok_id }}
+                        </div>
+                    </div>
+                    <div class="bg-gray-50 rounded-lg p-4">
+                        <div class="text-sm font-medium text-gray-500 mb-1">
+                            Publicerad
+                        </div>
+                        <div class="text-gray-900">
+                            {{ \Carbon\Carbon::parse($motion->publicerad)->format('Y-m-d') }}
+                        </div>
+                    </div>
+                    <div class="bg-gray-50 rounded-lg p-4">
+                        <div class="text-sm font-medium text-gray-500 mb-1">
+                            Systemdatum
+                        </div>
+                        <div class="text-gray-900">
+                            {{ \Carbon\Carbon::parse($motion->systemdatum)->format('Y-m-d H:i') }}
+                        </div>
+                    </div>
+                    <div class="bg-gray-50 rounded-lg p-4">
+                        <div class="text-sm font-medium text-gray-500 mb-1">
+                            Källa
+                        </div>
+                        <div class="text-gray-900">{{ $motion->kalla }}</div>
+                    </div>
+                </div>
+            </div>
+        @else
+            <!-- Motion Not Found -->
+            <div
+                class="bg-white rounded-lg shadow-md border border-gray-200 p-8 text-center"
+            >
+                <svg
+                    class="w-16 h-16 text-gray-400 mx-auto mb-4"
+                    fill="none"
+                    stroke="currentColor"
+                    viewBox="0 0 24 24"
+                >
+                    <path
+                        stroke-linecap="round"
+                        stroke-linejoin="round"
+                        stroke-width="2"
+                        d="M12 8v4m0 4h.01M21 12a9 9 0 11-18 0 9 9 0 0118 0z"
+                    ></path>
+                </svg>
+                <h3 class="text-lg font-medium text-gray-900 mb-2">
+                    Motion inte hittad
+                </h3>
+                <p class="text-gray-600 mb-4">
+                    Motionen med ID {{ $motionId }} kunde inte hittas.
+                </p>
+                <a
+                    wire:navigate
+                    href="{{ route('motion.search') }}"
+                    class="px-4 py-2 text-sm font-medium text-white bg-blue-600 rounded-md hover:bg-blue-700 focus:outline-none focus:ring-2 focus:ring-offset-2 focus:ring-blue-500"
+                >
+                    Tillbaka till sökning
+                </a>
+            </div>
+        @endif
+    </div>
+</div>

resources/views/livewire/person/search.blade.php

@@ -88,14 +88,15 @@
                         @foreach ($persons as $person)
                             <div
                                 class="bg-gray-50 rounded-lg p-4 hover:bg-gray-100 transition-colors border border-gray-200">
+                                <a wire:navigate href="{{ route('person.show', $person->intressent_id) }}">
                                     <div class="flex items-center">
                                         <img src="{{ $person->bild_url_80 ?? '' }}" alt="{{ $person->tilltalsnamn }}"
                                             class="w-16 h-16 rounded-lg object-cover mr-4 border border-gray-300">
                                         <div class="flex-1">
-                                        <a wire:navigate href="{{ route('person.show', $person->intressent_id) }}"
+                                            <span class="text-xl font-bold text-black transition-colors">
-                                            class="text-xl font-bold text-blue-600 hover:text-blue-700 transition-colors">
+                                                {{ $person->tilltalsnamn }} {{ $person->efternamn }}
-                                            {{ $person->tilltalsnamn }} {{ $person->efternamn }} ({{ $person->parti }})
+                                                ({{ $person->parti }})
-                                        </a>
+                                            </span>
                                             <div class="text-gray-600 mt-1 flex items-center gap-2">
                                                 <img src="{{ App\Enums\Parties::from($person->parti)->logo() }}"
                                                     width="32">
@@ -109,22 +110,24 @@
                                                 d="M9 5l7 7-7 7"></path>
                                         </svg>
                                     </div>
+                                </a>
                             </div>
                         @endforeach
                     </div>
                 </div>
-        </div>
             @elseif ($results && (!isset($results->personlista->person) || empty($results->personlista->person)))
                 <div class="bg-yellow-50 border border-yellow-200 rounded-lg p-6 max-w-4xl mx-auto">
                     <div class="flex items-center">
-                <svg class="w-5 h-5 text-yellow-600 mr-2" fill="none" stroke="currentColor" viewBox="0 0 24 24">
+                        <svg class="w-5 h-5 text-yellow-600 mr-2" fill="none" stroke="currentColor"
+                            viewBox="0 0 24 24">
                             <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2"
                                 d="M12 8v4m0 4h.01M21 12a9 9 0 11-18 0 9 9 0 0118 0z"></path>
                         </svg>
-                <span class="text-yellow-800 font-medium">Inga ledamöter hittades med de angivna sökkriterier.</span>
+                        <span class="text-yellow-800 font-medium">Inga ledamöter hittades med de angivna
+                            sökkriterier.</span>
                     </div>
                 </div>
             @endif
         </div>
-</div>
+    </div>
 </div>

resources/views/livewire/person/show.blade.php

@@ -2,306 +2,330 @@
     <div class="container mx-auto py-12 px-4">
         <!-- Breadcrumb Navigation -->
         <nav class="mb-8" aria-label="Breadcrumb">
-            <div class="bg-white rounded-lg shadow-sm border border-gray-200 px-4 py-3">
+            <div
+                class="bg-white rounded-lg shadow-sm border border-gray-200 px-4 py-3"
+            >
                 <ol class="flex items-center space-x-2 text-sm text-gray-600">
                     <li>
-                        <a wire:navigate href="{{ route('home') }}" class="text-blue-600 hover:text-blue-700 flex items-center">
+                        <a
-                            <svg class="w-4 h-4 mr-1" fill="none" stroke="currentColor" viewBox="0 0 24 24">
+                            wire:navigate
-                                <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2"
+                            href="{{ route('home') }}"
-                                    d="M3 12l2-2m0 0l7-7 7 7M5 10v10a1 1 0 001 1h3m10-11l2 2m-2-2v10a1 1 0 01-1 1h-3m-6 0a1 1 0 001-1v-4a1 1 0 011-1h2a1 1 0 011 1v4a1 1 0 001 1m-6 0h6">
+                            class="text-blue-600 hover:text-blue-700 flex items-center"
-                                </path>
+                        >
+                            <svg
+                                class="w-4 h-4 mr-1"
+                                fill="none"
+                                stroke="currentColor"
+                                viewBox="0 0 24 24"
+                            >
+                                <path
+                                    stroke-linecap="round"
+                                    stroke-linejoin="round"
+                                    stroke-width="2"
+                                    d="M3 12l2-2m0 0l7-7 7 7M5 10v10a1 1 0 001 1h3m10-11l2 2m-2-2v10a1 1 0 01-1 1h-3m-6 0a1 1 0 001-1v-4a1 1 0 011-1h2a1 1 0 011 1v4a1 1 0 001 1m-6 0h6"
+                                ></path>
                             </svg>
                             Hem
                         </a>
                     </li>
                     <li>
-                        <svg class="w-4 h-4 text-gray-400" fill="currentColor" viewBox="0 0 20 20">
+                        <svg
-                            <path fill-rule="evenodd"
+                            class="w-4 h-4 text-gray-400"
+                            fill="currentColor"
+                            viewBox="0 0 20 20"
+                        >
+                            <path
+                                fill-rule="evenodd"
                                 d="M7.293 14.707a1 1 0 010-1.414L10.586 10 7.293 6.707a1 1 0 011.414-1.414l4 4a1 1 0 010 1.414l-4 4a1 1 0 01-1.414 0z"
-                                clip-rule="evenodd"></path>
+                                clip-rule="evenodd"
+                            ></path>
                         </svg>
                     </li>
                     <li>
-                        <a wire:navigate href="{{ route('person.search') }}" class="text-blue-600 hover:text-blue-700">Sök
+                        <a
-                            Ledamöter</a>
+                            wire:navigate
+                            href="{{ route('person.search') }}"
+                            class="text-blue-600 hover:text-blue-700"
+                        >
+                            Sök Ledamöter
+                        </a>
                     </li>
                     <li>
-                        <svg class="w-4 h-4 text-gray-400" fill="currentColor" viewBox="0 0 20 20">
+                        <svg
-                            <path fill-rule="evenodd"
+                            class="w-4 h-4 text-gray-400"
+                            fill="currentColor"
+                            viewBox="0 0 20 20"
+                        >
+                            <path
+                                fill-rule="evenodd"
                                 d="M7.293 14.707a1 1 0 010-1.414L10.586 10 7.293 6.707a1 1 0 011.414-1.414l4 4a1 1 0 010 1.414l-4 4a1 1 0 01-1.414 0z"
-                                clip-rule="evenodd"></path>
+                                clip-rule="evenodd"
+                            ></path>
                         </svg>
                     </li>
                     <li class="font-medium text-gray-900">
-                        {{ $person->tilltalsnamn ?? 'Laddar...' }} {{ $person->efternamn ?? '' }}
+                        {{ $person->tilltalsnamn ?? 'Laddar...' }}
+                        {{ $person->efternamn ?? '' }}
                     </li>
                 </ol>
             </div>
         </nav>
         @if ($person)
             <!-- Main Profile Section -->
-            <div class="bg-white rounded-lg shadow-md border border-gray-200 p-8 mb-8">
+            <div
+                class="bg-white rounded-lg shadow-md border border-gray-200 p-8 mb-8"
+            >
                 <div class="flex flex-col md:flex-row gap-8">
                     <div class="md:w-48">
-                        <img src="{{ $person->bild_url_max ?? '' }}" alt="{{ $person->tilltalsnamn }}"
+                        <img
-                            class="w-full h-64 md:w-48 object-cover rounded-lg shadow-lg border border-gray-200">
+                            src="{{ $person->bild_url_max ?? '' }}"
+                            alt="{{ $person->tilltalsnamn }}"
+                            class="w-full h-64 md:w-48 object-cover rounded-lg shadow-lg border border-gray-200"
+                        />
+                        <span class="text-xs text-gray-500 mt-2 block">
+                            Foto: Sveriges Riksdag
+                        </span>
                     </div>
                     <div class="flex-1">
                         <div class="mb-6">
-                            <h1 class="text-4xl font-bold text-gray-900 mb-2">{{ $person->tilltalsnamn }}
+                            <h1 class="text-4xl font-bold text-gray-900 mb-2">
-                                {{ $person->efternamn }} ({{ $person->parti }})</h1>
+                                {{ $person->tilltalsnamn }}
+                                {{ $person->efternamn }}
+                                ({{ $person->parti }})
+                            </h1>
                             <div class="flex flex-wrap items-center gap-4 mb-4">
                                 <span
-                                    class="inline-flex items-center px-3 py-1 rounded-full text-sm font-medium bg-blue-100 text-blue-800 grap-2">
+                                    class="inline-flex items-center px-3 py-1 rounded-full text-sm font-medium bg-blue-100 text-blue-800 grap-2"
+                                >
                                     {{ App\Enums\Parties::from($person->parti)->label() }}
-                                    <img src="{{ App\Enums\Parties::from($person->parti)->logo() }}" width="32">
+                                    <img
+                                        src="{{ App\Enums\Parties::from($person->parti)->logo() }}"
+                                        width="32"
+                                    />
+                                </span>
+                                <span class="text-gray-600">
+                                    {{ $person->valkrets }} valkrets
                                 </span>
-                                <span class="text-gray-600">{{ $person->valkrets }} valkrets</span>
                             </div>
                         </div>
 
                         <div class="grid grid-cols-1 md:grid-cols-2 gap-4 mb-6">
                             <div class="bg-gray-50 rounded-lg p-4">
-                                <div class="text-sm font-medium text-gray-500 mb-1">Född</div>
+                                <div
-                                <div class="text-gray-900">{{ $person->fodd_ar }}</div>
+                                    class="text-sm font-medium text-gray-500 mb-1"
+                                >
+                                    Född
+                                </div>
+                                <div class="text-gray-900">
+                                    {{ $person->fodd_ar }}
+                                    ({{ Carbon\Carbon::parse($person->fodd_ar)->age }}
+                                    år)
+                                </div>
                             </div>
                             <div class="bg-gray-50 rounded-lg p-4">
-                                <div class="text-sm font-medium text-gray-500 mb-1">Kön</div>
+                                <div
-                                <div class="text-gray-900">{{ ucfirst($person->kon) }}</div>
+                                    class="text-sm font-medium text-gray-500 mb-1"
+                                >
+                                    Kön
+                                </div>
+                                <div class="text-gray-900">
+                                    {{ ucfirst($person->kon) }}
+                                </div>
                             </div>
                             <div class="bg-gray-50 rounded-lg p-4">
-                                <div class="text-sm font-medium text-gray-500 mb-1">Status</div>
+                                <div
-                                <div class="text-gray-900">{{ $person->status }}</div>
+                                    class="text-sm font-medium text-gray-500 mb-1"
+                                >
+                                    Status
+                                </div>
+                                <div class="text-gray-900">
+                                    {{ $person->status }}
+                                </div>
                             </div>
                             <div class="bg-gray-50 rounded-lg p-4">
-                                <div class="text-sm font-medium text-gray-500 mb-1">E-post</div>
+                                <div
+                                    class="text-sm font-medium text-gray-500 mb-1"
+                                >
+                                    E-post
+                                </div>
                                 <div class="text-gray-900 text-sm">
                                     {{ str_replace('[på]', '@', collect($person->personuppgift->uppgift ?? [])->firstWhere('kod', 'Officiell e-postadress')->uppgift[0] ?? '-') }}
                                 </div>
                             </div>
                         </div>
-
-                        <a href="{{ $this->riksdagen_url }}" target="_blank"
-                            class="inline-flex items-center px-4 py-2 bg-blue-600 text-white rounded-lg hover:bg-blue-700 transition-colors">
-                            <svg class="w-4 h-4 mr-2" fill="none" stroke="currentColor" viewBox="0 0 24 24">
-                                <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2"
-                                    d="M10 6H6a2 2 0 00-2 2v10a2 2 0 002 2h10a2 2 0 002-2v-4M14 4h6m0 0v6m0-6L10 14">
-                                </path>
-                            </svg>
-                            Visa på riksdagen.se
-                        </a>
                     </div>
                 </div>
             </div>
 
-            <!-- Assignments Section -->
+            @if (! empty($votesByYear))
-            <div class="bg-white rounded-lg shadow-md border border-gray-200 p-6 mb-8">
-                <div class="flex items-center mb-6">
-                    <div class="w-10 h-10 bg-blue-100 rounded-lg flex items-center justify-center mr-3">
-                        <svg class="w-5 h-5 text-blue-600" fill="none" stroke="currentColor" viewBox="0 0 24 24">
-                            <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2"
-                                d="M21 13.255A23.931 23.931 0 0112 15c-3.183 0-6.22-.62-9-1.745M16 6V4a2 2 0 00-2-2h-4a2 2 0 00-2-2v2m8 0H8m8 0v2a2 2 0 01-2 2H10a2 2 0 01-2-2V6">
-                            </path>
-                        </svg>
-                    </div>
-                    <h2 class="text-2xl font-bold text-gray-900">Uppdrag</h2>
-                </div>
-
-                <!-- Uppdrag tabs -->
-                <div class="border-b border-gray-200 mb-6">
-                    <nav class="-mb-px flex space-x-8">
-                        <button wire:click="selectUppdragTab('current')"
-                            class="py-3 px-1 border-b-2 font-medium text-sm transition-colors {{ $selectedUppdragTab == 'current' ? 'border-blue-500 text-blue-600' : 'border-transparent text-gray-500 hover:text-gray-700 hover:border-gray-300' }}">
-                            <span class="flex items-center">
-                                <svg class="w-4 h-4 mr-2" fill="none" stroke="currentColor" viewBox="0 0 24 24">
-                                    <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2"
-                                        d="M9 12l2 2 4-4m6 2a9 9 0 11-18 0 9 9 0 0118 0z"></path>
-                                </svg>
-                                Pågående ({{ count($currentUppdrag) }})
-                            </span>
-                        </button>
-                        <button wire:click="selectUppdragTab('previous')"
-                            class="py-3 px-1 border-b-2 font-medium text-sm transition-colors {{ $selectedUppdragTab == 'previous' ? 'border-blue-500 text-blue-600' : 'border-transparent text-gray-500 hover:text-gray-700 hover:border-gray-300' }}">
-                            <span class="flex items-center">
-                                <svg class="w-4 h-4 mr-2" fill="none" stroke="currentColor" viewBox="0 0 24 24">
-                                    <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2"
-                                        d="M12 8v4l3 3m6-3a9 9 0 11-18 0 9 9 0 0118 0z"></path>
-                                </svg>
-                                Tidigare ({{ count($previousUppdrag) }})
-                            </span>
-                        </button>
-                    </nav>
-                </div>
-
-                <!-- Current assignments -->
-                @if ($selectedUppdragTab == 'current' && !empty($currentUppdrag))
-                    <div class="space-y-3">
-                        @foreach ($currentUppdrag as $uppdrag)
-                            <div class="bg-green-50 border border-green-200 rounded-lg p-4">
-                                <div class="flex justify-between items-start">
-                                    <div>
-                                        <h4 class="font-semibold text-green-800">{{ $uppdrag->roll_kod }}</h4>
-                                        {{-- @if (!empty($uppdrag->uppgift[0]) && is_array($uppdrag->uppgift))
-                                            <p class="text-sm text-green-700 mt-1">{{ implode(', ', $uppdrag->uppgift) }}</p>
-                                        @endif --}}
-                                        <p class="text-sm text-green-600 mt-2">
-                                            <span class="font-medium">Typ:</span> {{ ucfirst($uppdrag->typ) }}
-                                            @if (isset($uppdrag->status) && $uppdrag->status)
-                                                | <span class="font-medium">Status:</span> {{ $uppdrag->status }}
-                                            @endif
-                                        </p>
-                                    </div>
-                                    <div class="text-right text-sm text-green-600">
-                                        <div>Från: {{ Carbon\Carbon::parse($uppdrag->from)->format('Y-m-d') }}</div>
-                                        @if (!empty($uppdrag->tom))
-                                            <div>Till: {{ Carbon\Carbon::parse($uppdrag->tom)->format('Y-m-d') }}</div>
-                                        @else
-                                            <div class="font-semibold text-green-700">Pågående</div>
-                                        @endif
-                                    </div>
-                                </div>
-                            </div>
-                        @endforeach
-                    </div>
-                @elseif($selectedUppdragTab == 'current' && empty($currentUppdrag))
-                    <p class="text-gray-500 italic">Inga pågående uppdrag.</p>
-                @endif
-
-                <!-- Previous assignments -->
-                @if ($selectedUppdragTab == 'previous' && !empty($previousUppdrag))
-                    <div class="space-y-3">
-                        @foreach ($previousUppdrag as $uppdrag)
-                            <div class="bg-gray-50 border border-gray-200 rounded-lg p-4">
-                                <div class="flex justify-between items-start">
-                                    <div>
-                                        <h4 class="font-semibold text-gray-800">{{ $uppdrag->roll_kod }}</h4>
-                                        {{-- @if (!empty($uppdrag->uppgift[0]) && is_array($uppdrag->uppgift))
-                                            <p class="text-sm text-gray-700 mt-1">{{ implode(', ', $uppdrag->uppgift) }}</p>
-                                        @endif --}}
-                                        <p class="text-sm text-gray-600 mt-2">
-                                            <span class="font-medium">Typ:</span> {{ ucfirst($uppdrag->typ) }}
-                                            @if (isset($uppdrag->status) && $uppdrag->status)
-                                                | <span class="font-medium">Status:</span> {{ $uppdrag->status }}
-                                            @endif
-                                        </p>
-                                    </div>
-                                    <div class="text-right text-sm text-gray-600">
-                                        <div>{{ Carbon\Carbon::parse($uppdrag->from)->format('Y-m-d') }} -
-                                            {{ Carbon\Carbon::parse($uppdrag->tom)->format('Y-m-d') }}</div>
-                                        <div class="text-xs text-gray-500 mt-1">
-                                            {{ Carbon\Carbon::parse($uppdrag->from)->diffForHumans(Carbon\Carbon::parse($uppdrag->tom), true) }}
-                                        </div>
-                                    </div>
-                                </div>
-                            </div>
-                        @endforeach
-                    </div>
-                @elseif($selectedUppdragTab == 'previous' && empty($previousUppdrag))
-                    <p class="text-gray-500 italic">Inga tidigare uppdrag registrerade.</p>
-                @endif
-            </div>
-            @if (!empty($votesByYear))
                 <!-- Voting Section -->
-                <div class="bg-white rounded-lg shadow-md border border-gray-200 p-6 mb-8">
+                <div
+                    class="bg-white rounded-lg shadow-md border border-gray-200 p-6 mb-8"
+                >
                     <div class="flex items-center mb-6">
-                        <div class="w-10 h-10 bg-blue-100 rounded-lg flex items-center justify-center mr-3">
+                        <div
-                            <svg class="w-5 h-5 text-blue-600" fill="none" stroke="currentColor"
+                            class="w-10 h-10 bg-blue-100 rounded-lg flex items-center justify-center mr-3"
-                                viewBox="0 0 24 24">
+                        >
-                                <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2"
+                            <svg
-                                    d="M9 5H7a2 2 0 00-2 2v10a2 2 0 002 2h8a2 2 0 002-2V7a2 2 0 00-2-2h-2M9 5a2 2 0 002 2h2a2 2 0 002-2M9 5a2 2 0 012-2h2a2 2 0 012 2m-6 9l2 2 4-4">
+                                class="w-5 h-5 text-blue-600"
-                                </path>
+                                fill="none"
+                                stroke="currentColor"
+                                viewBox="0 0 24 24"
+                            >
+                                <path
+                                    stroke-linecap="round"
+                                    stroke-linejoin="round"
+                                    stroke-width="2"
+                                    d="M9 5H7a2 2 0 00-2 2v10a2 2 0 002 2h8a2 2 0 002-2V7a2 2 0 00-2-2h-2M9 5a2 2 0 002 2h2a2 2 0 002-2M9 5a2 2 0 012-2h2a2 2 0 012 2m-6 9l2 2 4-4"
+                                />
                             </svg>
                         </div>
-                        <h2 class="text-2xl font-bold text-gray-900">Voteringar</h2>
+                        <h2 class="text-2xl font-bold text-gray-900">
+                            Voteringar
+                        </h2>
                     </div>
 
                     <!-- Year tabs -->
                     <div class="border-b border-gray-200 mb-4">
                         <nav class="-mb-px flex space-x-8">
                             @foreach (array_keys($votesByYear) as $year)
-                                <button wire:click="selectYear('{{ $year }}')"
+                                <button
-                                    class="cursor-pointer py-2 px-1 border-b-2 font-medium text-sm {{ $selectedYear == $year ? 'border-blue-500 text-blue-600' : 'border-transparent text-gray-500 hover:text-gray-700 hover:border-gray-300' }}">
+                                    wire:click="selectVotesYear('{{ $year }}')"
+                                    class="cursor-pointer py-2 px-1 border-b-2 font-medium text-sm {{ $votesSelectedYear == $year ? 'border-blue-500 text-blue-600' : 'border-transparent text-gray-500 hover:text-gray-700 hover:border-gray-300' }}"
+                                >
                                     {{ $year }}
                                 </button>
                             @endforeach
                         </nav>
                     </div>
-
+                    @if ($votesSelectedYear && isset($votesByYear[$votesSelectedYear]))
-                    @if ($selectedYear && isset($votesByYear[$selectedYear]))
+                        <!-- Voting Statistics -->
-                        <!-- Voting Statistics Chart -->
+                        <div
-                        <div class="mb-8 bg-gray-200 p-6 rounded-lg shadow border">
+                            class="mb-8 bg-gray-200 p-6 rounded-lg shadow border"
-                            @if (!empty($this->votingStatistics))
+                        >
+                            @if (! empty($this->votingStatistics))
                                 <div class="flex flex-col lg:flex-row gap-6">
-                                    <div style="height: 23rem;">
+                                    <div style="height: 23rem">
-                                        <livewire:livewire-pie-chart :pie-chart-model="$this->pieChartModel"
+                                        <livewire:livewire-pie-chart
-                                            key="{{ 'pie-chart-' . $selectedYear }}" />
+                                            :pie-chart-model="$this->pieChartModel"
+                                            key="{{ 'pie-chart-' . $votesSelectedYear }}"
+                                        />
                                     </div>
+
                                     <div class="lg:w-1/2 my-auto">
                                         <div class="space-y-2">
                                             @php($totalVotes = array_sum($this->votingStatistics))
+
                                             @foreach ($this->votingStatistics as $voteType => $count)
-                                                <div class="flex justify-between items-center p-3 bg-gray-50 rounded">
+                                                <div
-                                                    <span class="text-black font-medium">{{ $voteType }}</span>
+                                                    class="flex justify-between items-center p-3 bg-gray-50 rounded"
-                                                    <span class="text-black text-lg font-bold">{{ $count }}
+                                                >
-                                                        ({{ round(($count / $totalVotes) * 100, 2) }}%)</span>
+                                                    <span
+                                                        class="text-black font-medium"
+                                                    >
+                                                        {{ $voteType }}
+                                                    </span>
+                                                    <span
+                                                        class="text-black text-lg font-bold"
+                                                    >
+                                                        {{ $count }}
+                                                        ({{ round(($count / $totalVotes) * 100, 2) }}%)
+                                                    </span>
                                                 </div>
                                             @endforeach
+
                                             <div
-                                                class="flex justify-between items-center p-3 bg-blue-50 rounded border-t-2 border-blue-500">
+                                                class="flex justify-between items-center p-3 bg-blue-50 rounded border-t-2 border-blue-500"
-                                                <span class="text-black font-bold">Totalt antal voteringar</span>
+                                            >
                                                 <span
-                                                    class="text-black text-lg font-bold">{{ array_sum($this->votingStatistics) }}</span>
+                                                    class="text-black font-bold"
+                                                >
+                                                    Totalt antal voteringar
+                                                </span>
+                                                <span
+                                                    class="text-black text-lg font-bold"
+                                                >
+                                                    {{ $totalVotes }}
+                                                </span>
                                             </div>
                                         </div>
                                     </div>
                                 </div>
                             @else
-                                <p class="text-gray-500">Ingen voteringsstatistik tillgänglig för detta år.</p>
+                                <p class="text-gray-500">
+                                    Ingen voteringsstatistik tillgänglig för
+                                    detta år.
+                                </p>
                             @endif
                         </div>
-                    @endif
 
                         <!-- Votes table -->
-                    @if ($selectedYear && isset($votesByYear[$selectedYear]))
+                        <div
-                        <div class="overflow-x-auto" style="overflow-y: auto; display: block; max-height: 400px;">
+                            class="overflow-x-auto overflow-y-auto max-h-[400px]"
-                            <table class="min-w-full bg-white border border-gray-200">
+                        >
+                            <table
+                                class="min-w-full bg-white border border-gray-200"
+                            >
                                 <thead class="bg-gray-50 sticky top-0">
                                     <tr>
                                         <th
-                                            class="px-4 py-2 text-left text-xs font-medium text-gray-500 uppercase tracking-wider">
+                                            class="px-4 py-2 text-left text-xs font-medium text-gray-500 uppercase"
-                                            Datum</th>
+                                        >
+                                            Datum
+                                        </th>
                                         <th
-                                            class="px-4 py-2 text-left text-xs font-medium text-gray-500 uppercase tracking-wider">
+                                            class="px-4 py-2 text-left text-xs font-medium text-gray-500 uppercase"
-                                            Beteckning</th>
+                                        >
+                                            Beteckning
+                                        </th>
                                         <th
-                                            class="px-4 py-2 text-left text-xs font-medium text-gray-500 uppercase tracking-wider">
+                                            class="px-4 py-2 text-left text-xs font-medium text-gray-500 uppercase"
-                                            Punkt</th>
+                                        >
+                                            Punkt
+                                        </th>
                                         <th
-                                            class="px-4 py-2 text-left text-xs font-medium text-gray-500 uppercase tracking-wider">
+                                            class="px-4 py-2 text-left text-xs font-medium text-gray-500 uppercase"
-                                            Röst</th>
+                                        >
+                                            Röst
+                                        </th>
                                     </tr>
                                 </thead>
+
                                 <tbody class="divide-y divide-gray-100">
-                                    @foreach ($votesByYear[$selectedYear] as $vote)
+                                    @foreach ($votesByYear[$votesSelectedYear] as $vote)
                                         <tr class="bg-gray-200">
-                                            <td class="px-4 py-2 text-sm text-gray-900">
+                                            <td
-                                                {{ Carbon\Carbon::parse($vote->systemdatum)->format('Y-m-d') }}
+                                                class="px-4 py-2 text-sm text-gray-900"
+                                            >
+                                                {{ \Carbon\Carbon::parse($vote->systemdatum)->format('Y-m-d') }}
                                             </td>
+
                                             <td class="px-4 py-2 text-sm">
-                                                <a href="{{ $vote->votering_url_xml }}"
+                                                <a
-                                                    class="text-blue-600 hover:underline" target="_blank">
+                                                    href="{{ $vote->votering_url_xml }}"
+                                                    class="text-blue-600 hover:underline"
+                                                    target="_blank"
+                                                >
                                                     {{ $vote->beteckning }}
                                                 </a>
                                             </td>
-                                            <td class="px-4 py-2 text-sm text-gray-900">{{ $vote->punkt }}</td>
+
+                                            <td
+                                                class="px-4 py-2 text-sm text-gray-900"
+                                            >
+                                                {{ $vote->punkt }}
+                                            </td>
+
                                             <td class="px-4 py-2 text-sm">
                                                 <span
-                                                    class="inline-flex px-2 py-1 text-xs font-semibold rounded-full
+                                                    class="inline-flex px-2 py-1 text-xs font-semibold rounded-full {{
-                                                    {{ $vote->rost === 'Ja'
+                                                        $vote->rost === 'Ja'
                                                             ? 'bg-green-100 text-green-800'
                                                             : ($vote->rost === 'Nej'
                                                                 ? 'bg-red-100 text-red-800'
-                                                            : 'bg-gray-100 text-gray-800') }}">
+                                                                : 'bg-gray-100 text-gray-800')
+                                                    }}"
+                                                >
                                                     {{ $vote->rost }}
                                                 </span>
                                             </td>
@@ -310,18 +334,400 @@
                                 </tbody>
                             </table>
                         </div>
+                    @else
+                        <p class="text-gray-500">
+                            Inga voteringar tillgängliga för detta år.
+                        </p>
                     @endif
+                </div>
+            @endif
+
+            <!-- Motions Section -->
+            <div
+                class="bg-white rounded-lg shadow-md border border-gray-200 p-6 mb-8"
+            >
+                <div class="flex items-center mb-6">
+                    <div
+                        class="w-10 h-10 bg-green-100 rounded-lg flex items-center justify-center mr-3"
+                    >
+                        <svg
+                            class="w-5 h-5 text-green-600"
+                            fill="none"
+                            stroke="currentColor"
+                            viewBox="0 0 24 24"
+                        >
+                            <path
+                                stroke-linecap="round"
+                                stroke-linejoin="round"
+                                stroke-width="2"
+                                d="M9 12h6m-6 4h6m2 5H7a2 2 0 01-2-2V5a2 2 0 012-2h5.586a1 1 0 01.707.293l5.414 5.414a1 1 0 01.293.707V19a2 2 0 01-2 2z"
+                            ></path>
+                        </svg>
+                    </div>
+                    <h2 class="text-2xl font-bold text-gray-900">Motioner</h2>
+                </div>
+
+                <!-- Year tabs for motions -->
+                @if (! empty($motionsByYear))
+                    <div class="border-b border-gray-200 mb-4">
+                        <nav class="-mb-px flex space-x-8">
+                            @foreach (array_keys($motionsByYear) as $year)
+                                <button
+                                    wire:click="selectMotionsYear('{{ $year }}')"
+                                    class="cursor-pointer py-2 px-1 border-b-2 font-medium text-sm {{ $motionsSelectedYear == $year ? 'border-green-500 text-green-600' : 'border-transparent text-gray-500 hover:text-gray-700 hover:border-gray-300' }}"
+                                >
+                                    {{ $year }}
+                                    ({{ count($motionsByYear[$year]) }})
+                                </button>
+                            @endforeach
+                        </nav>
+                    </div>
+
+                    @if ($motionsSelectedYear && isset($motionsByYear[$motionsSelectedYear]))
+                        <div class="overflow-x-auto">
+                            <table class="min-w-full divide-y divide-gray-200">
+                                <thead class="bg-gray-50">
+                                    <tr>
+                                        <th
+                                            class="px-6 py-3 text-left text-xs font-medium text-gray-500 uppercase tracking-wider"
+                                        >
+                                            Beteckning
+                                        </th>
+                                        <th
+                                            class="px-6 py-3 text-left text-xs font-medium text-gray-500 uppercase tracking-wider"
+                                        >
+                                            Titel
+                                        </th>
+                                        <th
+                                            class="px-6 py-3 text-left text-xs font-medium text-gray-500 uppercase tracking-wider"
+                                        >
+                                            Typ
+                                        </th>
+                                        <th
+                                            class="px-6 py-3 text-left text-xs font-medium text-gray-500 uppercase tracking-wider"
+                                        >
+                                            Datum
+                                        </th>
+                                        <th
+                                            class="px-6 py-3 text-left text-xs font-medium text-gray-500 uppercase tracking-wider"
+                                        >
+                                            Status
+                                        </th>
+                                        <th
+                                            class="px-6 py-3 text-left text-xs font-medium text-gray-500 uppercase tracking-wider"
+                                        >
+                                            Åtgärder
+                                        </th>
+                                    </tr>
+                                </thead>
+                                <tbody
+                                    class="bg-white divide-y divide-gray-200"
+                                >
+                                    @foreach ($motionsByYear[$motionsSelectedYear] as $motion)
+                                        <tr class="hover:bg-gray-50">
+                                            <td
+                                                class="px-6 py-4 whitespace-nowrap text-sm font-medium text-gray-900"
+                                            >
+                                                {{ $motionsSelectedYear }}:{{ $motion->beteckning }}
+                                            </td>
+                                            <td
+                                                class="px-6 py-4 text-sm text-gray-900"
+                                            >
+                                                <div
+                                                    class="max-w-xs truncate"
+                                                    title="{{ $motion->titel }}"
+                                                >
+                                                    {{ $motion->titel }}
+                                                </div>
+                                                @if (! empty($motion->undertitel))
+                                                    <div
+                                                        class="text-xs text-gray-500 mt-1"
+                                                    >
+                                                        {{ $motion->undertitel }}
+                                                    </div>
+                                                @endif
+                                            </td>
+                                            <td
+                                                class="px-6 py-4 whitespace-nowrap text-sm text-gray-500"
+                                            >
+                                                <span
+                                                    class="inline-flex px-2 py-1 text-xs font-semibold rounded-full {{ $motion->subtyp == 'Partimotion' ? 'bg-blue-100 text-blue-800' : 'bg-gray-100 text-gray-800' }}"
+                                                >
+                                                    {{ $motion->subtyp }}
+                                                </span>
+                                            </td>
+                                            <td
+                                                class="px-6 py-4 whitespace-nowrap text-sm text-gray-500"
+                                            >
+                                                {{ \Carbon\Carbon::parse($motion->datum)->format('Y-m-d') }}
+                                            </td>
+                                            <td
+                                                class="px-6 py-4 whitespace-nowrap text-sm text-gray-500"
+                                            >
+                                                <span
+                                                    class="inline-flex px-2 py-1 text-xs font-semibold rounded-full {{
+                                                        $motion->status == 'LagdTillHandlingarna'
+                                                            ? 'bg-yellow-100 text-yellow-800'
+                                                            : ($motion->status == 'Avslutad'
+                                                                ? 'bg-green-100 text-green-800'
+                                                                : 'bg-gray-100 text-gray-800')
+                                                    }}"
+                                                >
+                                                    {{ $motion->status }}
+                                                </span>
+                                            </td>
+                                            <td
+                                                class="px-6 py-4 whitespace-nowrap text-sm font-medium"
+                                            >
+                                                @if (! empty($motion->dokument_url_html))
+                                                    <a
+                                                        href="https:{{ $motion->dokument_url_html }}"
+                                                        target="_blank"
+                                                        class="text-green-600 hover:text-green-900 mr-4"
+                                                    >
+                                                        <svg
+                                                            class="w-4 h-4 inline"
+                                                            fill="none"
+                                                            stroke="currentColor"
+                                                            viewBox="0 0 24 24"
+                                                        >
+                                                            <path
+                                                                stroke-linecap="round"
+                                                                stroke-linejoin="round"
+                                                                stroke-width="2"
+                                                                d="M10 6H6a2 2 0 00-2 2v10a2 2 0 002 2h10a2 2 0 002-2v-4M14 4h6m0 0v6m0-6L10 14"
+                                                            ></path>
+                                                        </svg>
+                                                        Läs
+                                                    </a>
+                                                @endif
+                                            </td>
+                                        </tr>
+                                    @endforeach
+                                </tbody>
+                            </table>
+                        </div>
+                    @else
+                        <p class="text-gray-500">
+                            Inga motioner tillgängliga för detta år.
+                        </p>
+                    @endif
+                @else
+                    <p class="text-gray-500">
+                        Inga motioner tillgängliga för denna person.
+                    </p>
+                @endif
+            </div>
+
+            <!-- Assignments Section -->
+            <div
+                class="bg-white rounded-lg shadow-md border border-gray-200 p-6 mb-8"
+            >
+                <div class="flex items-center mb-6">
+                    <div
+                        class="w-10 h-10 bg-blue-100 rounded-lg flex items-center justify-center mr-3"
+                    >
+                        <svg
+                            class="w-5 h-5 text-blue-600"
+                            fill="none"
+                            stroke="currentColor"
+                            viewBox="0 0 24 24"
+                        >
+                            <path
+                                stroke-linecap="round"
+                                stroke-linejoin="round"
+                                stroke-width="2"
+                                d="M21 13.255A23.931 23.931 0 0112 15c-3.183 0-6.22-.62-9-1.745M16 6V4a2 2 0 00-2-2h-4a2 2 0 00-2-2v2m8 0H8m8 0v2a2 2 0 01-2 2H10a2 2 0 01-2-2V6"
+                            ></path>
+                        </svg>
+                    </div>
+                    <h2 class="text-2xl font-bold text-gray-900">Uppdrag</h2>
+                </div>
+
+                <!-- Uppdrag tabs -->
+                <div class="border-b border-gray-200 mb-6">
+                    <nav class="-mb-px flex space-x-8">
+                        <button
+                            wire:click="selectUppdragTab('current')"
+                            class="py-3 px-1 border-b-2 font-medium text-sm transition-colors {{ $selectedUppdragTab == 'current' ? 'border-blue-500 text-blue-600' : 'border-transparent text-gray-500 hover:text-gray-700 hover:border-gray-300' }}"
+                        >
+                            <span class="flex items-center">
+                                <svg
+                                    class="w-4 h-4 mr-2"
+                                    fill="none"
+                                    stroke="currentColor"
+                                    viewBox="0 0 24 24"
+                                >
+                                    <path
+                                        stroke-linecap="round"
+                                        stroke-linejoin="round"
+                                        stroke-width="2"
+                                        d="M9 12l2 2 4-4m6 2a9 9 0 11-18 0 9 9 0 0118 0z"
+                                    ></path>
+                                </svg>
+                                Pågående ({{ count($currentUppdrag) }})
+                            </span>
+                        </button>
+                        <button
+                            wire:click="selectUppdragTab('previous')"
+                            class="py-3 px-1 border-b-2 font-medium text-sm transition-colors {{ $selectedUppdragTab == 'previous' ? 'border-blue-500 text-blue-600' : 'border-transparent text-gray-500 hover:text-gray-700 hover:border-gray-300' }}"
+                        >
+                            <span class="flex items-center">
+                                <svg
+                                    class="w-4 h-4 mr-2"
+                                    fill="none"
+                                    stroke="currentColor"
+                                    viewBox="0 0 24 24"
+                                >
+                                    <path
+                                        stroke-linecap="round"
+                                        stroke-linejoin="round"
+                                        stroke-width="2"
+                                        d="M12 8v4l3 3m6-3a9 9 0 11-18 0 9 9 0 0118 0z"
+                                    ></path>
+                                </svg>
+                                Tidigare ({{ count($previousUppdrag) }})
+                            </span>
+                        </button>
+                    </nav>
+                </div>
+
+                <!-- Current assignments -->
+                @if ($selectedUppdragTab == 'current' && ! empty($currentUppdrag))
+                    <div class="space-y-3">
+                        @foreach ($currentUppdrag as $uppdrag)
+                            <div
+                                class="bg-green-50 border border-green-200 rounded-lg p-4"
+                            >
+                                <div class="flex justify-between items-start">
+                                    <div>
+                                        <h4
+                                            class="font-semibold text-green-800"
+                                        >
+                                            {{ $uppdrag->roll_kod }}
+                                        </h4>
+                                        {{--
+                                            @if (!empty($uppdrag->uppgift[0]) && is_array($uppdrag->uppgift))
+                                            <p class="text-sm text-green-700 mt-1">{{ implode(', ', $uppdrag->uppgift) }}</p>
+                                            @endif
+                                        --}}
+                                        <p class="text-sm text-green-600 mt-2">
+                                            <span class="font-medium">
+                                                Typ:
+                                            </span>
+                                            {{ ucfirst($uppdrag->typ) }}
+                                            @if (isset($uppdrag->status) && $uppdrag->status)
+                                                |
+                                                <span class="font-medium">
+                                                    Status:
+                                                </span>
+                                                {{ $uppdrag->status }}
+                                            @endif
+                                        </p>
+                                    </div>
+                                    <div
+                                        class="text-right text-sm text-green-600"
+                                    >
+                                        <div>
+                                            Från:
+                                            {{ Carbon\Carbon::parse($uppdrag->from)->format('Y-m-d') }}
+                                        </div>
+
+                                        @if (! empty($uppdrag->tom))
+                                            <div>
+                                                Till:
+                                                {{ Carbon\Carbon::parse($uppdrag->tom)->format('Y-m-d') }}
+                                            </div>
+                                        @else
+                                            <div
+                                                class="font-semibold text-green-700"
+                                            >
+                                                Pågående
+                                            </div>
+                                        @endif
+                                    </div>
+                                </div>
+                            </div>
+                        @endforeach
+                    </div>
+                @elseif ($selectedUppdragTab == 'current' && empty($currentUppdrag))
+                    <p class="text-gray-500 italic">Inga pågående uppdrag.</p>
+                @endif
+
+                <!-- Previous assignments -->
+                @if ($selectedUppdragTab == 'previous' && ! empty($previousUppdrag))
+                    <div class="space-y-3">
+                        @foreach ($previousUppdrag as $uppdrag)
+                            <div
+                                class="bg-gray-50 border border-gray-200 rounded-lg p-4"
+                            >
+                                <div class="flex justify-between items-start">
+                                    <div>
+                                        <h4 class="font-semibold text-gray-800">
+                                            {{ $uppdrag->roll_kod }}
+                                        </h4>
+                                        {{--
+                                            @if (!empty($uppdrag->uppgift[0]) && is_array($uppdrag->uppgift))
+                                            <p class="text-sm text-gray-700 mt-1">{{ implode(', ', $uppdrag->uppgift) }}</p>
+                                            @endif
+                                        --}}
+                                        <p class="text-sm text-gray-600 mt-2">
+                                            <span class="font-medium">
+                                                Typ:
+                                            </span>
+                                            {{ ucfirst($uppdrag->typ) }}
+                                            @if (isset($uppdrag->status) && $uppdrag->status)
+                                                |
+                                                <span class="font-medium">
+                                                    Status:
+                                                </span>
+                                                {{ $uppdrag->status }}
+                                            @endif
+                                        </p>
+                                    </div>
+                                    <div
+                                        class="text-right text-sm text-gray-600"
+                                    >
+                                        <div>
+                                            {{ Carbon\Carbon::parse($uppdrag->from)->format('Y-m-d') }}
+                                            -
+                                            {{ Carbon\Carbon::parse($uppdrag->tom)->format('Y-m-d') }}
+                                        </div>
+                                        <div class="text-xs text-gray-500 mt-1">
+                                            {{ Carbon\Carbon::parse($uppdrag->from)->diffForHumans(Carbon\Carbon::parse($uppdrag->tom), true) }}
+                                        </div>
+                                    </div>
+                                </div>
+                            </div>
+                        @endforeach
+                    </div>
+                @elseif ($selectedUppdragTab == 'previous' && empty($previousUppdrag))
+                    <p class="text-gray-500 italic">
+                        Inga tidigare uppdrag registrerade.
+                    </p>
                 @endif
             </div>
 
             <!-- Biography Section -->
-    <div class="bg-white rounded-lg shadow-md border border-gray-200 p-6 mb-8">
+            <div
+                class="bg-white rounded-lg shadow-md border border-gray-200 p-6 mb-8"
+            >
                 <div class="flex items-center mb-6">
-            <div class="w-10 h-10 bg-blue-100 rounded-lg flex items-center justify-center mr-3">
+                    <div
-                <svg class="w-5 h-5 text-blue-600" fill="none" stroke="currentColor" viewBox="0 0 24 24">
+                        class="w-10 h-10 bg-blue-100 rounded-lg flex items-center justify-center mr-3"
-                    <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2"
+                    >
-                        d="M12 6.253v13m0-13C10.832 5.477 9.246 5 7.5 5S4.168 5.477 3 6.253v13C4.168 18.477 5.754 18 7.5 18s3.332.477 4.5 1.253m0-13C13.168 5.477 14.754 5 16.5 5c1.746 0 3.332.477 4.5 1.253v13C19.832 18.477 18.246 18 16.5 18c-1.746 0-3.332.477-4.5 1.253">
+                        <svg
-                    </path>
+                            class="w-5 h-5 text-blue-600"
+                            fill="none"
+                            stroke="currentColor"
+                            viewBox="0 0 24 24"
+                        >
+                            <path
+                                stroke-linecap="round"
+                                stroke-linejoin="round"
+                                stroke-width="2"
+                                d="M12 6.253v13m0-13C10.832 5.477 9.246 5 7.5 5S4.168 5.477 3 6.253v13C4.168 18.477 5.754 18 7.5 18s3.332.477 4.5 1.253m0-13C13.168 5.477 14.754 5 16.5 5c1.746 0 3.332.477 4.5 1.253v13C19.832 18.477 18.246 18 16.5 18c-1.746 0-3.332.477-4.5 1.253"
+                            ></path>
                         </svg>
                     </div>
                     <h2 class="text-2xl font-bold text-gray-900">Biografi</h2>
@@ -329,22 +735,40 @@
                 <div class="space-y-4">
                     @foreach (collect($person->personuppgift->uppgift ?? [])->where('typ', 'biografi') as $bio)
                         <div class="bg-gray-50 rounded-lg p-4">
-                    <div class="font-semibold text-gray-900 mb-2">{{ $bio->kod }}</div>
+                            <div class="font-semibold text-gray-900 mb-2">
+                                {{ $bio->kod }}
+                            </div>
                             <div class="text-gray-700">
-                        {{ is_array($bio->uppgift) ? implode(', ', $bio->uppgift) : $bio->uppgift }}</div>
+                                {{ is_array($bio->uppgift) ? implode(', ', $bio->uppgift) : $bio->uppgift }}
+                            </div>
                         </div>
                     @endforeach
                 </div>
             </div>
-@else
+        @else
-    <div class="bg-white rounded-lg shadow-md border border-gray-200 p-8 text-center">
+            <div
-        <svg class="w-16 h-16 text-gray-400 mx-auto mb-4" fill="none" stroke="currentColor" viewBox="0 0 24 24">
+                class="bg-white rounded-lg shadow-md border border-gray-200 p-8 text-center"
-            <path stroke-linecap="round" stroke-linejoin="round" stroke-width="2"
+            >
-                d="M12 8v4m0 4h.01M21 12a9 9 0 11-18 0 9 9 0 0118 0z"></path>
+                <svg
+                    class="w-16 h-16 text-gray-400 mx-auto mb-4"
+                    fill="none"
+                    stroke="currentColor"
+                    viewBox="0 0 24 24"
+                >
+                    <path
+                        stroke-linecap="round"
+                        stroke-linejoin="round"
+                        stroke-width="2"
+                        d="M12 8v4m0 4h.01M21 12a9 9 0 11-18 0 9 9 0 0118 0z"
+                    ></path>
                 </svg>
-        <h3 class="text-lg font-medium text-gray-900 mb-2">Person inte hittad</h3>
+                <h3 class="text-lg font-medium text-gray-900 mb-2">
-        <p class="text-gray-600">Personen kunde inte hittas i databasen.</p>
+                    Person inte hittad
+                </h3>
+                <p class="text-gray-600">
+                    Personen kunde inte hittas i databasen.
+                </p>
             </div>
         @endif
-</div>
+    </div>
 </div>

routes/web.php

@@ -1,5 +1,10 @@
 <?php
 
+use App\Livewire\HomePage;
+use App\Livewire\Motion\Search as MotionSearch;
+use App\Livewire\Motion\Show as MotionShow;
+use App\Livewire\Person\Search as PersonSearch;
+use App\Livewire\Person\Show as PersonShow;
 use App\Livewire\Settings\Appearance;
 use App\Livewire\Settings\Password;
 use App\Livewire\Settings\Profile;
@@ -7,15 +12,14 @@ use App\Livewire\Settings\TwoFactor;
 use Illuminate\Support\Facades\Route;
 use Laravel\Fortify\Features;
 
-use App\Livewire\HomePage;
-use App\Livewire\Person\Search as PersonSearch;
-use App\Livewire\Person\Show as PersonShow;
-
 Route::get('/', HomePage::class)->name('home');
 
 Route::get('/ledamot', PersonSearch::class)->name('person.search');
 Route::get('/ledamot/{personId}', PersonShow::class)->name('person.show');
 
+Route::get('/motion', MotionSearch::class)->name('motion.search');
+Route::get('/motion/{motionId}', MotionShow::class)->name('motion.show');
+
 Route::view('dashboard', 'dashboard')
     ->middleware(['auth', 'verified'])
     ->name('dashboard');